angeloylgomisin H

ID: ALA1092320

Cas Number: 66056-22-2

PubChem CID: 26204131

Product Number: A649011, Order Now?

Max Phase: Preclinical

Molecular Formula: C28H36O8

Molecular Weight: 500.59

Molecule Type: Small molecule

Names and Identifiers

Synonyms: Angeloylgomisin H | Angeloylgomisin H|UNII-Y16R9MI4T6|66056-22-2|Y16R9MI4T6|Angeloyl gomisin H|2-Butenoic acid, 2-methyl-, (6S,7S,12aR)-5,6,7,8-tetrahydro-7-hydroxy-2,3,10,11,12-pentamethoxy-6,7-dimethyldibenzo(a,C)cycloocten-1-yl ester, (2Z)-|[(9S,10S)-10-hydroxy-4,5,14,15,16-pentamethoxy-9,10-dimethyl-3-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] (Z)-2-methylbut-2-enoate|CHEMBL1092320|SCHEMBL10040207|CHEBI:184022|AKOS040760113|AC-34147|Q27294127

Canonical SMILES:  C/C=C(/C)C(=O)Oc1c(OC)c(OC)cc2c1-c1c(cc(OC)c(OC)c1OC)C[C@](C)(O)[C@@H](C)C2

Standard InChI:  InChI=1S/C28H36O8/c1-10-15(2)27(29)36-26-21-17(12-19(31-5)24(26)34-8)11-16(3)28(4,30)14-18-13-20(32-6)23(33-7)25(35-9)22(18)21/h10,12-13,16,30H,11,14H2,1-9H3/b15-10-/t16-,28-/m0/s1

Standard InChI Key:  ZSAUXCVJDYCLRS-XSIRQHFTSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   14.5027    1.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5016    0.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2164    0.5681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9328    0.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9300    1.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2146    2.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2181   -0.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5019   -0.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5013   -1.4906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2162   -1.9041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9332   -1.4874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9302   -0.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5958    0.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6833   -0.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1542    0.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1833   -0.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2121    3.0461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9254    3.4608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7882    2.2207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7880    3.0457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7868    0.5691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0726    0.9821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7879   -0.2530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0729   -0.6646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7865   -1.9026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7859   -2.7276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2171   -2.7291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9320   -3.1408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8958   -0.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7375    1.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8667    0.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3590   -0.2512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0719   -1.4896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3600    0.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6440   -0.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6429   -1.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6 17  1  0
  8  9  1  0
 17 18  1  0
  4  5  1  0
  1 19  1  0
  9 10  2  0
 19 20  1  0
  2  3  1  0
  2 21  1  0
 10 11  1  0
 21 22  1  0
  5  6  2  0
  8 23  1  0
 11 12  2  0
 23 24  1  0
 12  7  1  0
  9 25  1  0
  3  7  1  0
 25 26  1  0
  6  1  1  0
 10 27  1  0
  4 13  1  0
 27 28  1  0
  1  2  2  0
 16 29  1  1
 12 14  1  0
 15 30  1  0
  3  4  2  0
 15 31  1  1
 13 15  1  0
 24 32  1  0
  7  8  2  0
 24 33  2  0
 14 16  1  0
 32 34  1  0
 15 16  1  0
 32 35  2  0
 35 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1092320

   Angeloylgomisin H

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 500.59

Molecular Weight (Monoisotopic): 500.2410

AlogP: 4.75

#Rotatable Bonds: 7

Polar Surface Area: 92.68

Molecular Species: NEUTRAL

HBA: 8

HBD: 1

#RO5 Violations: 1

HBA (Lipinski): 8

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 4.92

CX LogD: 4.92

Aromatic Rings: 2

Heavy Atoms: 36

QED Weighted: 0.33

Np Likeness Score: 1.72

References

1. Blunder M, Pferschy-Wenzig EM, Fabian WM, Hüfner A, Kunert O, Saf R, Schühly W, Bauer R..  (2010)  Derivatives of schisandrin with increased inhibitory potential on prostaglandin E(2) and leukotriene B(4) formation in vitro.,  18  (7): [PMID:20236826] [10.1016/j.bmc.2009.10.031]

2. Slanina J, Páchniková G, Carnecká M, Porubová Koubíková L, Adámková L, Humpa O, Smejkal K, Slaninová I..  (2014)  Identification of key structural characteristics of Schisandra chinensis lignans involved in P-glycoprotein inhibition.,  77  (10): [PMID:25302569] [10.1021/np500521v]

Source

Source(1):

• Scientific Literature