The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl 2-((S)-1-((1S,2R)-2-(4-(methylthio)benzamido)cyclohexyl)-2-oxopyrrolidin-3-ylcarbamoyl)-4-(trifluoromethyl)phenylcarbamate ID: ALA1092435
PubChem CID: 46886483
Max Phase: Preclinical
Molecular Formula: C31H37F3N4O5S
Molecular Weight: 634.72
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CSc1ccc(C(=O)N[C@@H]2CCCC[C@@H]2N2CC[C@@H](NC(=O)c3cc(C(F)(F)F)ccc3NC(=O)OC(C)(C)C)C2=O)cc1
Standard InChI: InChI=1S/C31H37F3N4O5S/c1-30(2,3)43-29(42)37-22-14-11-19(31(32,33)34)17-21(22)27(40)36-24-15-16-38(28(24)41)25-8-6-5-7-23(25)35-26(39)18-9-12-20(44-4)13-10-18/h9-14,17,23-25H,5-8,15-16H2,1-4H3,(H,35,39)(H,36,40)(H,37,42)/t23-,24-,25+/m1/s1
Standard InChI Key: CLYBLBAEHMYFEI-SDHSZQHLSA-N
Molfile:
RDKit 2D
44 47 0 0 0 0 0 0 0 0999 V2000
16.2574 -7.0200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9710 -7.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6864 -7.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9691 -8.2591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3960 -7.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1109 -7.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1132 -6.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3946 -5.7905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6827 -6.2031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3936 -4.9655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1075 -4.5521 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.6786 -4.5540 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.3886 -4.1370 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.3916 -8.2656 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1038 -8.6819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0994 -9.5069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8205 -8.2732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5327 -8.6895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2494 -8.2809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5283 -9.5145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2427 -9.0995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8402 -7.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8391 -8.0523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5539 -8.4652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2703 -8.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2675 -7.2213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5521 -6.8122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1257 -6.8126 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.1255 -5.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9855 -8.4632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9867 -9.2882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6993 -8.0496 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6980 -7.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4152 -6.8140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4159 -5.9926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7026 -5.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9869 -5.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9846 -6.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1292 -7.2274 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3697 -8.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1945 -8.0358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4672 -7.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8109 -6.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8304 -5.9325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10 11 1 0
22 23 2 0
5 6 1 0
23 24 1 0
10 12 1 0
24 25 2 0
1 2 1 0
25 26 1 0
10 13 1 0
26 27 2 0
27 22 1 0
6 7 2 0
22 28 1 0
5 14 1 0
28 29 1 0
2 4 2 0
25 30 1 0
14 15 1 0
30 31 2 0
7 8 1 0
30 32 1 0
15 16 2 0
33 32 1 6
33 34 1 0
15 17 1 0
8 9 2 0
17 18 1 0
9 3 1 0
33 38 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
18 19 1 0
34 39 1 6
39 40 1 0
3 5 2 0
18 20 1 0
8 10 1 0
18 21 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 39 1 0
2 3 1 0
43 44 2 0
42 1 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 634.72Molecular Weight (Monoisotopic): 634.2437AlogP: 5.85#Rotatable Bonds: 7Polar Surface Area: 116.84Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.24CX Basic pKa: ┄CX LogP: 4.97CX LogD: 4.97Aromatic Rings: 2Heavy Atoms: 44QED Weighted: 0.33Np Likeness Score: -1.08
References 1. Cherney RJ, Mo R, Meyer DT, Voss ME, Yang MG, Santella JB, Duncia JV, Lo YC, Yang G, Miller PB, Scherle PA, Zhao Q, Mandlekar S, Cvijic ME, Barrish JC, Decicco CP, Carter PH.. (2010) gamma-Lactams as glycinamide replacements in cyclohexane-based CC chemokine receptor 2 (CCR2) antagonists., 20 (8): [PMID:20346664 ] [10.1016/j.bmcl.2010.03.035 ]