(3S)-3-[((3-Amino-3-carboxy)propyl)(hydroxy)phosphinyl]-2-(phosphonomethyl)propanoic Acid

ID: ALA1092593

PubChem CID: 46197779

Max Phase: Preclinical

Molecular Formula: C8H17NO9P2

Molecular Weight: 333.17

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N[C@@H](CCP(=O)(O)C(CC(=O)O)CP(=O)(O)O)C(=O)O

Standard InChI:  InChI=1S/C8H17NO9P2/c9-6(8(12)13)1-2-19(14,15)5(3-7(10)11)4-20(16,17)18/h5-6H,1-4,9H2,(H,10,11)(H,12,13)(H,14,15)(H2,16,17,18)/t5?,6-/m0/s1

Standard InChI Key:  OTYXWVKEWNCHHC-GDVGLLTNSA-N

Molfile:  

     RDKit          2D

 20 19  0  0  0  0  0  0  0  0999 V2000
   -2.8372  -19.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1226  -19.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4081  -19.5117    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6937  -19.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4081  -20.3367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4163  -18.6820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5516  -19.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2661  -19.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9806  -19.0992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2661  -20.3367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5516  -18.2742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0208  -19.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7353  -19.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4497  -19.5117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7353  -18.2742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6937  -18.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4081  -17.8616    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4081  -17.0366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1226  -18.2742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1267  -17.4445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  7 11  1  1
  3  6  2  0
  4 12  1  0
  1  2  1  0
 12 13  1  0
  1  7  1  0
 13 14  1  0
  3  4  1  0
 13 15  2  0
  7  8  1  0
  4 16  1  0
 16 17  1  0
  8  9  1  0
 17 18  2  0
  3  5  1  0
 17 19  1  0
  8 10  2  0
 17 20  1  0
M  END

Associated Targets(non-human)

Grm4 Metabotropic glutamate receptor 4 (663 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 333.17Molecular Weight (Monoisotopic): 333.0379AlogP: -0.92#Rotatable Bonds: 9
Polar Surface Area: 195.45Molecular Species: ZWITTERIONHBA: 5HBD: 6
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 7#RO5 Violations (Lipinski): 1
CX Acidic pKa: 1.50CX Basic pKa: 9.53CX LogP: -5.00CX LogD: -13.29
Aromatic Rings: Heavy Atoms: 20QED Weighted: 0.29Np Likeness Score: 0.80

References

1. Selvam C, Oueslati N, Lemasson IA, Brabet I, Rigault D, Courtiol T, Cesarini S, Triballeau N, Bertrand HO, Goudet C, Pin JP, Acher FC..  (2010)  A virtual screening hit reveals new possibilities for developing group III metabotropic glutamate receptor agonists.,  53  (7): [PMID:20218620] [10.1021/jm901523t]

Source