N-cyclohexyl-4-((6-(4-(propylsulfonyl)piperazin-1-yl)pyridin-3-yloxy)methyl)piperidine-1-carboxamide

ID: ALA1092657

PubChem CID: 46884988

Max Phase: Preclinical

Molecular Formula: C25H41N5O4S

Molecular Weight: 507.70

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCS(=O)(=O)N1CCN(c2ccc(OCC3CCN(C(=O)NC4CCCCC4)CC3)cn2)CC1

Standard InChI:  InChI=1S/C25H41N5O4S/c1-2-18-35(32,33)30-16-14-28(15-17-30)24-9-8-23(19-26-24)34-20-21-10-12-29(13-11-21)25(31)27-22-6-4-3-5-7-22/h8-9,19,21-22H,2-7,10-18,20H2,1H3,(H,27,31)

Standard InChI Key:  UWZMWQPVUDFMAB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   16.0777   -4.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0766   -5.4357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7914   -5.8485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5078   -5.4352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5050   -4.6047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7896   -4.1955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3593   -4.1915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3611   -3.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6507   -2.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9339   -3.3625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9321   -4.1885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6471   -4.6053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2230   -5.8466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9368   -5.4329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6519   -5.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6491   -6.6674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3601   -7.0787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0764   -6.6686    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0771   -5.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3615   -5.4267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7900   -7.0826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7881   -7.9076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5053   -6.6717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2209   -2.9475    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.5049   -3.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6333   -2.3583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8042   -2.3583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7919   -2.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0760   -3.3524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5017   -8.3217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4960   -9.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2055   -9.5607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9233   -9.1533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9271   -8.3273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2131   -7.9088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  5  1  0
  2  3  1  0
  5  6  2  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
  7 12  1  0
 18 21  1  0
  8  9  1  0
 21 22  1  0
  9 10  1  0
 21 23  2  0
 10 11  1  0
 10 24  1  0
 11 12  1  0
 24 25  1  0
  1  7  1  0
 24 26  2  0
  6  1  1  0
 24 27  2  0
  4 13  1  0
 25 28  1  0
  7  8  1  0
 28 29  1  0
 13 14  1  0
 22 30  1  0
 30 31  1  0
  1  2  2  0
 14 15  1  0
 15 16  1  0
  3  4  2  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
M  END

Associated Targets(Human)

GPR119 Tclin Glucose-dependent insulinotropic receptor (4762 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 507.70Molecular Weight (Monoisotopic): 507.2879AlogP: 3.08#Rotatable Bonds: 8
Polar Surface Area: 95.08Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.73CX LogP: 2.30CX LogD: 2.30
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.58Np Likeness Score: -2.04

References

1. Wu Y, Kuntz JD, Carpenter AJ, Fang J, Sauls HR, Gomez DJ, Ammala C, Xu Y, Hart S, Tadepalli S..  (2010)  2,5-Disubstituted pyridines as potent GPR119 agonists.,  20  (8): [PMID:20227877] [10.1016/j.bmcl.2010.02.083]

Source