The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-((S)-1-cyclohexyl-2-((S)-2-(4-(4-fluorophenyl)benzo[d]thiazol-2-yl)pyrrolidin-1-yl)-2-oxoethyl)-2-(methylamino)propanamide ID: ALA1092759
PubChem CID: 46884021
Max Phase: Preclinical
Molecular Formula: C29H35FN4O2S
Molecular Weight: 522.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN[C@@H](C)C(=O)N[C@H](C(=O)N1CCC[C@H]1c1nc2c(-c3ccc(F)cc3)cccc2s1)C1CCCCC1
Standard InChI: InChI=1S/C29H35FN4O2S/c1-18(31-2)27(35)32-25(20-8-4-3-5-9-20)29(36)34-17-7-11-23(34)28-33-26-22(10-6-12-24(26)37-28)19-13-15-21(30)16-14-19/h6,10,12-16,18,20,23,25,31H,3-5,7-9,11,17H2,1-2H3,(H,32,35)/t18-,23-,25-/m0/s1
Standard InChI Key: ZAVJGZJOAOWWTO-WYRQLCSISA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
10.1500 -9.3058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8656 -9.7165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1500 -8.4803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5811 -9.3058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8656 -10.5422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2968 -9.7165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5811 -8.4803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0123 -9.3058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7278 -9.7165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0123 -8.4803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7278 -10.5422 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4392 -9.3058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1925 -9.6394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7463 -9.0289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3356 -8.3133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5280 -8.4842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3675 -10.4470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8139 -11.0617 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.1181 -10.7854 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7260 -8.0724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7279 -7.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0148 -6.8337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2979 -7.2453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2943 -8.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0324 -11.6064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2251 -11.7761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9698 -12.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5209 -13.1724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3306 -12.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5820 -12.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3852 -12.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9314 -12.6538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7339 -12.4820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9868 -11.6994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4311 -11.0887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6306 -11.2638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7898 -11.5259 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 6
18 26 1 0
25 19 1 0
19 17 2 0
10 20 1 0
8 10 1 1
1 3 1 0
9 11 2 0
4 6 1 0
9 12 1 0
10 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
12 13 1 0
1 2 1 0
25 26 2 0
4 7 2 0
26 27 1 0
2 4 1 0
27 28 2 0
6 8 1 0
28 29 1 0
13 14 1 0
29 30 2 0
30 25 1 0
14 15 1 0
30 31 1 0
15 16 1 0
31 32 2 0
16 12 1 0
32 33 1 0
33 34 2 0
13 17 1 1
34 35 1 0
17 18 1 0
35 36 2 0
36 31 1 0
8 9 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.69Molecular Weight (Monoisotopic): 522.2465AlogP: 5.44#Rotatable Bonds: 7Polar Surface Area: 74.33Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.50CX Basic pKa: 8.60CX LogP: 5.06CX LogD: 3.84Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.43Np Likeness Score: -0.85
References 1. Cohen F, Koehler MF, Bergeron P, Elliott LO, Flygare JA, Franklin MC, Gazzard L, Keteltas SF, Lau K, Ly CQ, Tsui V, Fairbrother WJ.. (2010) Antagonists of inhibitor of apoptosis proteins based on thiazole amide isosteres., 20 (7): [PMID:20189383 ] [10.1016/j.bmcl.2010.02.021 ]