The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(6-(2-chlorophenylamino)-1H-indazol-3-yl)-5-(4-(dimethylamino)butanamido)benzoic acid ID: ALA1092764
PubChem CID: 9549178
Max Phase: Preclinical
Molecular Formula: C26H26ClN5O3
Molecular Weight: 491.98
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCCC(=O)Nc1cc(C(=O)O)cc(-c2n[nH]c3cc(Nc4ccccc4Cl)ccc23)c1
Standard InChI: InChI=1S/C26H26ClN5O3/c1-32(2)11-5-8-24(33)29-19-13-16(12-17(14-19)26(34)35)25-20-10-9-18(15-23(20)30-31-25)28-22-7-4-3-6-21(22)27/h3-4,6-7,9-10,12-15,28H,5,8,11H2,1-2H3,(H,29,33)(H,30,31)(H,34,35)
Standard InChI Key: QHYSKDAWIUFROA-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-1.4253 -0.7288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5115 0.0916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7108 -1.1413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1789 -1.0644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3185 0.2632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9595 0.7047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0037 -0.7288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7108 -1.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7310 -0.4513 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5734 1.0478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2144 1.4894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7182 -1.1413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0037 -2.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0214 1.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7182 -1.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4326 -0.7288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0037 -3.2038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2763 2.4455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1471 -1.1413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7182 -3.6163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7243 3.0586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8616 -0.7288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1471 -1.9663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9792 3.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9173 2.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5760 -1.1413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4272 4.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7862 4.0147 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.3653 3.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2905 -0.7288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6202 4.2848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0050 -1.1413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7195 -0.7288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0050 -1.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7108 -3.6163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
2 5 1 0
2 6 2 0
3 7 2 0
3 8 1 0
4 9 1 0
5 9 1 0
10 5 2 0
11 6 1 0
12 7 1 0
13 8 2 0
10 14 1 0
11 14 2 0
12 15 2 0
12 16 1 0
13 15 1 0
13 17 1 0
14 18 1 0
19 16 1 0
17 20 1 0
17 35 2 0
21 18 1 0
19 22 1 0
19 23 2 0
21 24 1 0
21 25 2 0
22 26 1 0
24 27 2 0
24 28 1 0
25 29 1 0
26 30 1 0
27 31 1 0
29 31 2 0
30 32 1 0
33 32 1 0
34 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.98Molecular Weight (Monoisotopic): 491.1724AlogP: 5.61#Rotatable Bonds: 9Polar Surface Area: 110.35Molecular Species: ZWITTERIONHBA: 5HBD: 4#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.80CX Basic pKa: 9.65CX LogP: 1.95CX LogD: 1.95Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.24Np Likeness Score: -1.57
References 1. Siddiqui MA, Reddy PA.. (2010) Small molecule JNK (c-Jun N-terminal kinase) inhibitors., 53 (8): [PMID:20146479 ] [10.1021/jm9003279 ]