Phenyl-2-deoxy-2-[3'-(8''-hydroxy-3''-methyl-1'',4''-dioxo-1'',4''-dihydronaphthalen-2''-yl)pentanamido]-1-thio-alpha-D-glucopyranoside

ID: ALA1093142

Max Phase: Preclinical

Molecular Formula: C28H31NO8S

Molecular Weight: 541.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1=C(CCCCC(=O)N[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]2Sc2ccccc2)C(=O)c2c(O)cccc2C1=O

Standard InChI:  InChI=1S/C28H31NO8S/c1-15-17(25(34)22-18(24(15)33)11-7-12-19(22)31)10-5-6-13-21(32)29-23-27(36)26(35)20(14-30)37-28(23)38-16-8-3-2-4-9-16/h2-4,7-9,11-12,20,23,26-28,30-31,35-36H,5-6,10,13-14H2,1H3,(H,29,32)/t20-,23-,26-,27-,28-/m1/s1

Standard InChI Key:  HXNLIDZRYOFVCO-JKFDDXDISA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    9.7091   -5.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7091   -6.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4213   -6.6506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1333   -6.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1333   -5.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4213   -5.0004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8472   -6.6558    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4213   -7.4756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9952   -6.6558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9934   -5.0067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2801   -5.4214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8490   -5.0067    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.8515   -4.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5679   -3.7745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5706   -2.9502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8568   -2.5347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1387   -2.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1394   -3.7725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5623   -6.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2763   -6.6579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5635   -5.4192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9915   -6.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7053   -6.6599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4205   -6.2484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1344   -6.6620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1269   -7.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8368   -7.8981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8432   -6.2460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5576   -6.6641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5531   -7.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2618   -7.8995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9755   -7.4915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9760   -6.6662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2666   -6.2567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4098   -7.8926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8426   -5.4210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8344   -8.7231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2675   -5.4317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  9  1  6
  7 19  1  0
  2  3  1  0
 19 20  1  0
  1 10  1  1
 19 21  2  0
  3  4  1  0
 20 22  1  0
 10 11  1  0
 22 23  1  0
  4  5  1  0
 23 24  1  0
  5 12  1  6
 24 25  1  0
 25 26  2  0
  5  6  1  0
 12 13  1  0
 25 28  1  0
 26 27  1  0
 27 30  1  0
 29 28  1  0
 13 14  2  0
  4  7  1  6
 29 30  2  0
 14 15  1  0
 30 31  1  0
  1  2  1  0
 31 32  2  0
 15 16  2  0
 32 33  1  0
  3  8  1  1
 33 34  2  0
 34 29  1  0
 16 17  1  0
 26 35  1  0
  1  6  1  0
 28 36  2  0
 17 18  2  0
 27 37  2  0
 18 13  1  0
 34 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA1093142

    ---

Associated Targets(non-human)

mshB LmbE-related protein (42 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 541.62Molecular Weight (Monoisotopic): 541.1770AlogP: 2.36#Rotatable Bonds: 9
Polar Surface Area: 153.39Molecular Species: NEUTRALHBA: 9HBD: 5
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.26CX Basic pKa: CX LogP: 2.82CX LogD: 2.77
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.30Np Likeness Score: 0.97

References

1. Gammon DW, Steenkamp DJ, Mavumengwana V, Marakalala MJ, Mudzunga TT, Hunter R, Munyololo M..  (2010)  Conjugates of plumbagin and phenyl-2-amino-1-thioglucoside inhibit MshB, a deacetylase involved in the biosynthesis of mycothiol.,  18  (7): [PMID:20304659] [10.1016/j.bmc.2010.02.049]

Source