The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Phenyl-2-deoxy-2-[3'-(8''-hydroxy-3''-methyl-1'',4''-dioxo-1'',4''-dihydronaphthalen-2''-yl)hexanamido]-1-thio-alpha-Dglucopyranoside ID: ALA1093143
Max Phase: Preclinical
Molecular Formula: C29H33NO8S
Molecular Weight: 555.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(CCCCCC(=O)N[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]2Sc2ccccc2)C(=O)c2c(O)cccc2C1=O
Standard InChI: InChI=1S/C29H33NO8S/c1-16-18(26(35)23-19(25(16)34)12-8-13-20(23)32)11-6-3-7-14-22(33)30-24-28(37)27(36)21(15-31)38-29(24)39-17-9-4-2-5-10-17/h2,4-5,8-10,12-13,21,24,27-29,31-32,36-37H,3,6-7,11,14-15H2,1H3,(H,30,33)/t21-,24-,27-,28-,29-/m1/s1
Standard InChI Key: RZUKWCGTIQBYBZ-WQCIBWCFSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
-4.8875 -11.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8875 -12.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1755 -13.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4635 -12.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4635 -11.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1755 -11.4833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7496 -13.1385 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.1755 -13.9583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.6014 -13.1385 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.6032 -11.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3169 -11.9042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7478 -11.4896 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.7454 -10.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0290 -10.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0262 -9.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7400 -9.0179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4581 -9.4327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4573 -10.2556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0345 -12.7271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3207 -13.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0333 -11.9021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6056 -12.7291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1083 -13.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8234 -12.7312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5372 -13.1448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2523 -12.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9608 -13.1489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9655 -11.4999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2463 -11.9095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6792 -11.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6724 -12.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3817 -13.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0982 -12.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1010 -11.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3912 -11.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5316 -11.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9695 -10.6749 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9572 -13.9739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3758 -13.9810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7 19 1 0
2 3 1 0
19 20 1 0
1 10 1 1
19 21 2 0
3 4 1 0
20 22 1 0
10 11 1 0
22 23 1 0
4 5 1 0
23 24 1 0
5 12 1 6
24 25 1 0
5 6 1 0
25 26 1 0
26 27 1 0
12 13 1 0
13 14 2 0
26 29 2 0
27 31 1 0
30 28 1 0
28 29 1 0
4 7 1 6
14 15 1 0
30 31 2 0
1 2 1 0
31 32 1 0
15 16 2 0
32 33 2 0
3 8 1 1
33 34 1 0
16 17 1 0
34 35 2 0
35 30 1 0
1 6 1 0
29 36 1 0
17 18 2 0
28 37 2 0
18 13 1 0
27 38 2 0
2 9 1 6
32 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 555.65Molecular Weight (Monoisotopic): 555.1927AlogP: 2.75#Rotatable Bonds: 10Polar Surface Area: 153.39Molecular Species: NEUTRALHBA: 9HBD: 5#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.26CX Basic pKa: ┄CX LogP: 3.27CX LogD: 3.21Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.28Np Likeness Score: 0.97
References 1. Gammon DW, Steenkamp DJ, Mavumengwana V, Marakalala MJ, Mudzunga TT, Hunter R, Munyololo M.. (2010) Conjugates of plumbagin and phenyl-2-amino-1-thioglucoside inhibit MshB, a deacetylase involved in the biosynthesis of mycothiol., 18 (7): [PMID:20304659 ] [10.1016/j.bmc.2010.02.049 ]