The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,2-difluoro-1-(4-((6-(4-(propylsulfonyl)piperazin-1-yl)pyridin-3-yloxy)methyl)piperidin-1-yl)ethanone ID: ALA1093190
PubChem CID: 46884989
Max Phase: Preclinical
Molecular Formula: C20H30F2N4O4S
Molecular Weight: 460.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCS(=O)(=O)N1CCN(c2ccc(OCC3CCN(C(=O)C(F)F)CC3)cn2)CC1
Standard InChI: InChI=1S/C20H30F2N4O4S/c1-2-13-31(28,29)26-11-9-24(10-12-26)18-4-3-17(14-23-18)30-15-16-5-7-25(8-6-16)20(27)19(21)22/h3-4,14,16,19H,2,5-13,15H2,1H3
Standard InChI Key: YYUKEXGSOFPCPC-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
-1.6804 -12.8820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6816 -13.7093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9668 -14.1221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2505 -13.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2534 -12.8784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9686 -12.4693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3988 -12.4653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3970 -11.6394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1074 -11.2272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8241 -11.6363 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8259 -12.4623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1109 -12.8790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4646 -14.1202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1783 -13.7065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8934 -14.1179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8906 -14.9409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6015 -15.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3178 -14.9421 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3185 -14.1162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6029 -13.7003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0312 -15.3561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0294 -16.1810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7465 -14.9452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5370 -11.2214 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.2529 -11.6312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1245 -10.6322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9538 -10.6322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.9658 -11.2163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6836 -11.6262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3141 -16.5919 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.7429 -16.5950 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14 15 1 0
15 16 1 0
3 4 2 0
4 5 1 0
2 3 1 0
5 6 2 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
7 12 1 0
18 21 1 0
8 9 1 0
21 22 1 0
9 10 1 0
21 23 2 0
10 11 1 0
10 24 1 0
11 12 1 0
24 25 1 0
1 7 1 0
24 26 2 0
6 1 1 0
24 27 2 0
4 13 1 0
25 28 1 0
7 8 1 0
28 29 1 0
13 14 1 0
22 30 1 0
1 2 2 0
22 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.55Molecular Weight (Monoisotopic): 460.1956AlogP: 1.83#Rotatable Bonds: 8Polar Surface Area: 83.05Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.65CX Basic pKa: 5.73CX LogP: 1.03CX LogD: 1.02Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.59Np Likeness Score: -2.08
References 1. Wu Y, Kuntz JD, Carpenter AJ, Fang J, Sauls HR, Gomez DJ, Ammala C, Xu Y, Hart S, Tadepalli S.. (2010) 2,5-Disubstituted pyridines as potent GPR119 agonists., 20 (8): [PMID:20227877 ] [10.1016/j.bmcl.2010.02.083 ]