2-((8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl methanesulfonate

ID: ALA1093281

PubChem CID: 10179654

Max Phase: Preclinical

Molecular Formula: C22H32O5S

Molecular Weight: 408.56

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)COS(C)(=O)=O

Standard InChI:  InChI=1S/C22H32O5S/c1-21-10-8-15(23)12-14(21)4-5-16-17-6-7-19(20(24)13-27-28(3,25)26)22(17,2)11-9-18(16)21/h12,16-19H,4-11,13H2,1-3H3/t16-,17-,18-,19+,21-,22-/m0/s1

Standard InChI Key:  ZSVXIYUTHGYDPV-XUCMERPOSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -3.7022  -24.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7022  -23.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9905  -23.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9905  -25.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2746  -24.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5587  -25.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8429  -24.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8429  -23.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1312  -23.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6535  -23.6071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1382  -22.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6531  -22.2728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0660  -21.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8902  -21.5546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1312  -22.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1312  -21.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8429  -22.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5587  -22.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5587  -23.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2746  -23.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2746  -22.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5587  -24.1750    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8429  -22.9375    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1312  -24.1750    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4170  -24.9994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6521  -20.8440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2999  -20.8387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1239  -20.8790    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.9474  -20.8700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1083  -21.7039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1412  -20.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  1
 13 14  1  0
 12 15  1  0
  9 15  1  0
 15 16  1  1
 15 17  1  0
 17 18  1  0
 18 19  1  0
  8 19  1  0
 19 20  1  0
  3 20  1  0
  5 20  1  0
 20 21  1  1
 19 22  1  6
  8 23  1  1
  9 24  1  6
  1 25  2  0
  1  2  1  0
 13 26  2  0
  2  3  1  0
 14 27  1  0
  1  4  1  0
 27 28  1  0
  4  5  2  0
 28 29  1  0
  5  6  1  0
 28 30  2  0
  6  7  1  0
 28 31  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA1093281

   [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] methanesulfonate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 408.56

Molecular Weight (Monoisotopic): 408.1970

AlogP: 3.68

#Rotatable Bonds: 4

Polar Surface Area: 77.51

Molecular Species: NEUTRAL

HBA: 5

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): 5

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 3.27

CX LogD: 3.27

Aromatic Rings: ┄

Heavy Atoms: 28

QED Weighted: 0.66

Np Likeness Score: 1.62

References

1. Dexheimer TS, Gediya LK, Stephen AG, Weidlich I, Antony S, Marchand C, Interthal H, Nicklaus M, Fisher RJ, Njar VC, Pommier Y..  (2009)  4-Pregnen-21-ol-3,20-dione-21-(4-bromobenzenesulfonate) (NSC 88915) and related novel steroid derivatives as tyrosyl-DNA phosphodiesterase (Tdp1) inhibitors.,  52  (22): [PMID:19883083] [10.1021/jm901061s]

Source

Source(1):

• Scientific Literature