The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-amino-N-(2-chloro-5-(3-methoxypropyl)benzyl)-N-cyclopropyl-2-(4-(3-(2,6-dichloro-4-methylphenoxy)propyl)benzyl)propanamide ID: ALA1093286
PubChem CID: 46883798
Max Phase: Preclinical
Molecular Formula: C34H41Cl3N2O3
Molecular Weight: 632.07
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COCCCc1ccc(Cl)c(CN(C(=O)[C@H](CN)Cc2ccc(CCCOc3c(Cl)cc(C)cc3Cl)cc2)C2CC2)c1
Standard InChI: InChI=1S/C34H41Cl3N2O3/c1-23-17-31(36)33(32(37)18-23)42-16-4-5-24-7-9-26(10-8-24)19-27(21-38)34(40)39(29-12-13-29)22-28-20-25(6-3-15-41-2)11-14-30(28)35/h7-11,14,17-18,20,27,29H,3-6,12-13,15-16,19,21-22,38H2,1-2H3/t27-/m0/s1
Standard InChI Key: YYIOQINMOGBBMF-MHZLTWQESA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
12.6784 0.6655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6772 -0.1621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3954 -0.5772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1106 -0.1616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1075 0.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3934 1.0760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3906 1.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1024 2.3181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8216 1.9057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5334 2.3228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2525 1.9103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2530 1.0881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9621 0.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6750 1.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6694 1.9226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9552 2.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9481 3.1558 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.5360 0.6767 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
13.3951 -1.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1081 -1.8126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8261 -1.4026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5391 -1.8130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8263 -0.5777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5388 -2.6380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2524 -1.4030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9655 -1.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9612 -2.6356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6733 -3.0505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3922 -2.6358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3896 -1.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6722 -1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6677 -0.5751 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.1279 -3.3520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9529 -3.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1079 -2.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3947 -3.0522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6727 -3.8754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9591 -4.2851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9585 -5.1101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2495 -5.5243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2489 -6.3493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3947 0.6861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 10 1 0
20 21 1 0
2 3 1 0
21 22 1 0
10 11 1 0
21 23 2 0
5 6 2 0
22 24 1 0
11 12 2 0
22 25 1 0
6 1 1 0
25 26 1 0
12 13 1 0
26 27 2 0
1 2 2 0
27 28 1 0
13 14 2 0
28 29 2 0
6 7 1 0
29 30 1 0
14 15 1 0
30 31 2 0
31 26 1 0
3 4 2 0
31 32 1 0
33 24 1 0
34 33 1 0
24 34 1 0
15 16 2 0
16 11 1 0
7 8 1 0
20 35 1 6
16 17 1 0
35 36 1 0
28 37 1 0
12 18 1 0
37 38 1 0
8 9 1 0
38 39 1 0
3 19 1 0
39 40 1 0
4 5 1 0
40 41 1 0
19 20 1 0
14 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 632.07Molecular Weight (Monoisotopic): 630.2183AlogP: 7.85#Rotatable Bonds: 16Polar Surface Area: 64.79Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.97CX LogP: 8.28CX LogD: 6.71Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.16Np Likeness Score: -0.72
References 1. Chen A, Bayly C, Bezençon O, Richard-Bildstein S, Dubé D, Dubé L, Gagné S, Gallant M, Gaudreault M, Grimm E, Houle R, Lacombe P, Laliberté S, Lévesque JF, Liu S, MacDonald D, Mackay B, Martin D, McKay D, Powell D, Remen L, Soisson S, Toulmond S.. (2010) Design and optimization of a substituted amino propanamide series of renin inhibitors for the treatment of hypertension., 20 (7): [PMID:20206513 ] [10.1016/j.bmcl.2010.02.036 ]