The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-3,3-dimethyltriaz-1-ene-N-[4-methyl-3-(4-pyridin-3-yl-pyrimidin-2-ylamino)-phenyl]-benzamide ID: ALA109329
PubChem CID: 10095381
Max Phase: Preclinical
Molecular Formula: C25H24N8O
Molecular Weight: 452.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)c2ccc(/N=N/N(C)C)cc2)cc1Nc1nccc(-c2cccnc2)n1
Standard InChI: InChI=1S/C25H24N8O/c1-17-6-9-21(28-24(34)18-7-10-20(11-8-18)31-32-33(2)3)15-23(17)30-25-27-14-12-22(29-25)19-5-4-13-26-16-19/h4-16H,1-3H3,(H,28,34)(H,27,29,30)/b32-31+
Standard InChI Key: XMZXIXKACCBNIE-QNEJGDQOSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
3.6417 -1.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6417 -2.6417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2292 -0.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3667 1.9375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0792 -1.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3625 -1.3917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2375 -1.3750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9250 -3.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3625 1.1125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7917 -1.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9250 -1.4000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5167 -0.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5167 -1.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9250 -3.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0875 -2.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9417 -0.1375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6542 2.3583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -5.1250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8000 -0.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5167 0.6958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0792 0.6958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8000 -3.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2125 -2.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2125 -1.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5250 -2.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8042 1.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0792 -0.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -4.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2042 -4.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9250 -5.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3667 -3.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6542 3.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9417 1.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2042 -5.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 7 1 0
4 9 2 0
5 6 1 0
6 1 1 0
7 13 1 0
8 2 2 0
9 21 1 0
10 5 1 0
11 1 2 0
12 3 1 0
13 10 2 0
14 8 1 0
15 5 2 0
16 3 2 0
17 4 1 0
18 28 2 0
19 12 1 0
20 12 2 0
21 26 2 0
22 15 1 0
23 24 2 0
24 11 1 0
25 22 2 0
26 20 1 0
27 19 2 0
28 14 1 0
29 14 2 0
30 34 2 0
31 15 1 0
32 17 1 0
33 17 1 0
34 29 1 0
23 8 1 0
25 13 1 0
30 18 1 0
27 21 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.52Molecular Weight (Monoisotopic): 452.2073AlogP: 5.40#Rotatable Bonds: 7Polar Surface Area: 107.76Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.69CX Basic pKa: 4.26CX LogP: 4.98CX LogD: 4.98Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.29Np Likeness Score: -1.77
References 1. Rachid Z, Katsoulas A, Brahimi F, Jean-Claude BJ.. (2003) Synthesis of pyrimidinopyridine-triazene conjugates targeted to abl tyrosine kinase., 13 (19): [PMID:12951113 ] [10.1016/s0960-894x(03)00553-5 ] 2. Cui J, Fu R, Zhou LH, Chen SP, Li GW, Qian SX, Liu S.. (2013) BCR-ABL tyrosine kinase inhibitor pharmacophore model derived from a series of phenylaminopyrimidine-based (PAP) derivatives., 23 (8): [PMID:23473682 ] [10.1016/j.bmcl.2013.01.113 ]