(S)-N-((S)-1-cyclohexyl-2-((S)-2-(5-methyl-7-phenylthiazolo[5,4-d]pyrimidin-2-yl)pyrrolidin-1-yl)-2-oxoethyl)-2-(methylamino)propanamide

ID: ALA1093356

PubChem CID: 46884084

Max Phase: Preclinical

Molecular Formula: C28H36N6O2S

Molecular Weight: 520.70

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN[C@@H](C)C(=O)N[C@H](C(=O)N1CCC[C@H]1c1nc2c(-c3ccccc3)nc(C)nc2s1)C1CCCCC1

Standard InChI:  InChI=1S/C28H36N6O2S/c1-17(29-3)25(35)32-23(20-13-8-5-9-14-20)28(36)34-16-10-15-21(34)26-33-24-22(19-11-6-4-7-12-19)30-18(2)31-27(24)37-26/h4,6-7,11-12,17,20-21,23,29H,5,8-10,13-16H2,1-3H3,(H,32,35)/t17-,21-,23-/m0/s1

Standard InChI Key:  LPSXMSKJMIDTCG-HYVJGQCMSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   -3.4456   -1.0704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7301   -1.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4456   -0.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0146   -1.0704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7301   -2.3067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -1.4811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0146   -0.2447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5835   -1.0704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1321   -1.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5835   -0.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1321   -2.3067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8434   -1.0704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5967   -1.4039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1505   -0.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7398   -0.0779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9322   -0.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7716   -2.2115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2182   -2.8261    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5224   -2.5498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1302    0.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1322    0.9850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5810    1.4017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2978    0.9901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3015    0.1619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4366   -3.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6292   -3.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3739   -4.3231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9251   -4.9367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7347   -4.7624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9862   -3.9801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7894   -3.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3355   -4.4182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1379   -4.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3908   -3.4639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8351   -2.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0348   -3.0283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6717   -5.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  5  1  6
 18 26  1  0
 25 19  1  0
 19 17  2  0
 10 20  1  0
  8 10  1  1
  1  3  1  0
  9 11  2  0
  4  6  1  0
  9 12  1  0
 10 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 12 13  1  0
  1  2  1  0
 25 26  2  0
  4  7  2  0
 26 27  1  0
  2  4  1  0
 27 28  2  0
  6  8  1  0
 28 29  1  0
 13 14  1  0
 29 30  2  0
 30 25  1  0
 14 15  1  0
 30 31  1  0
 15 16  1  0
 31 32  2  0
 16 12  1  0
 32 33  1  0
 33 34  2  0
 13 17  1  1
 34 35  1  0
 17 18  1  0
 35 36  2  0
 36 31  1  0
  8  9  1  0
 28 37  1  0
M  END

Associated Targets(Human)

XIAP Tchem Inhibitor of apoptosis protein 3 (3673 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BIRC7 Tchem Baculoviral IAP repeat-containing protein 7 (64 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 520.70Molecular Weight (Monoisotopic): 520.2620AlogP: 4.40#Rotatable Bonds: 7
Polar Surface Area: 100.11Molecular Species: BASEHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.19CX Basic pKa: 8.60CX LogP: 4.17CX LogD: 2.94
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.48Np Likeness Score: -0.70

References

1. Cohen F, Koehler MF, Bergeron P, Elliott LO, Flygare JA, Franklin MC, Gazzard L, Keteltas SF, Lau K, Ly CQ, Tsui V, Fairbrother WJ..  (2010)  Antagonists of inhibitor of apoptosis proteins based on thiazole amide isosteres.,  20  (7): [PMID:20189383] [10.1016/j.bmcl.2010.02.021]

Source