The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-Phenylsulfonylfurazan-3-yloxy)pentylidenebis(phosphonic) acid ID: ALA1093435
PubChem CID: 46885684
Max Phase: Preclinical
Molecular Formula: C13H18N2O10P2S
Molecular Weight: 456.31
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=P(O)(O)C(CCCCOc1nonc1S(=O)(=O)c1ccccc1)P(=O)(O)O
Standard InChI: InChI=1S/C13H18N2O10P2S/c16-26(17,18)11(27(19,20)21)8-4-5-9-24-12-13(15-25-14-12)28(22,23)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2,(H2,16,17,18)(H2,19,20,21)
Standard InChI Key: MMZZEFWKJCYZRC-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
8.7832 -8.0701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4657 -8.5329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1181 -8.0282 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8382 -7.2480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0136 -7.2797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2660 -6.5452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0905 -6.5641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5190 -5.8596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3435 -5.8784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7722 -5.1738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5965 -5.1927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0252 -4.4881 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
13.9925 -5.9162 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
13.5639 -6.6207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4316 -6.6064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7947 -6.0887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9783 -3.6633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7529 -4.8648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7134 -4.0369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5062 -6.6297 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.9178 -6.0394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1379 -5.2344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5503 -4.6444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7439 -4.8586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5284 -5.6681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1175 -6.2546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7887 -7.0348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2188 -6.2146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13 14 2 0
6 7 1 0
13 15 1 0
2 3 1 0
13 16 1 0
7 8 1 0
12 17 1 0
3 4 2 0
12 18 2 0
8 9 1 0
12 19 1 0
4 5 1 0
5 20 1 0
9 10 1 0
20 21 1 0
5 1 2 0
21 22 2 0
10 11 1 0
22 23 1 0
1 2 1 0
23 24 2 0
11 12 1 0
24 25 1 0
4 6 1 0
25 26 2 0
26 21 1 0
11 13 1 0
20 27 2 0
20 28 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.31Molecular Weight (Monoisotopic): 456.0157AlogP: 1.13#Rotatable Bonds: 10Polar Surface Area: 197.35Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 1.21CX Basic pKa: ┄CX LogP: 0.00CX LogD: -4.75Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.29Np Likeness Score: -0.86
References 1. Lolli ML, Rolando B, Tosco P, Chaurasia S, Di Stilo A, Lazzarato L, Gorassini E, Ferracini R, Oliaro-Bosso S, Fruttero R, Gasco A.. (2010) Synthesis and preliminary pharmacological characterisation of a new class of nitrogen-containing bisphosphonates (N-BPs)., 18 (7): [PMID:20299227 ] [10.1016/j.bmc.2010.02.058 ]