The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
isopropyl 4-(2-(6-(4-(propylsulfonyl)piperazin-1-yl)pyridin-3-yloxy)ethyl)piperidine-1-carboxylate ID: ALA1093453
PubChem CID: 46885170
Max Phase: Preclinical
Molecular Formula: C23H38N4O5S
Molecular Weight: 482.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCS(=O)(=O)N1CCN(c2ccc(OCCC3CCN(C(=O)OC(C)C)CC3)cn2)CC1
Standard InChI: InChI=1S/C23H38N4O5S/c1-4-17-33(29,30)27-14-12-25(13-15-27)22-6-5-21(18-24-22)31-16-9-20-7-10-26(11-8-20)23(28)32-19(2)3/h5-6,18-20H,4,7-17H2,1-3H3
Standard InChI Key: ATWCWUVYNZSTIK-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
-1.2223 -26.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2234 -27.3607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5086 -27.7735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2078 -27.3602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2050 -26.5297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5104 -26.1205 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9407 -26.1165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9389 -25.2906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6493 -24.8783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3661 -25.2875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3679 -26.1135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6529 -26.5303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9230 -27.7716 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0791 -24.8725 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.7951 -25.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6667 -24.2833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4958 -24.2833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.5081 -24.8674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6368 -27.3579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3519 -27.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0657 -27.3557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7775 -27.7715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4891 -27.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4921 -26.5360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7772 -26.1225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0592 -26.5342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2075 -26.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9211 -26.5392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2093 -25.3001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6364 -26.1283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3500 -26.5423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6383 -25.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2260 -25.2774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14 16 2 0
14 17 2 0
4 5 1 0
15 18 1 0
2 3 1 0
13 19 1 0
5 6 2 0
19 20 1 0
7 12 1 0
20 21 1 0
21 22 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
1 7 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
6 1 1 0
24 27 1 0
4 13 1 0
27 28 1 0
7 8 1 0
27 29 2 0
10 14 1 0
28 30 1 0
1 2 2 0
30 31 1 0
14 15 1 0
30 32 1 0
3 4 2 0
18 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.65Molecular Weight (Monoisotopic): 482.2563AlogP: 2.97#Rotatable Bonds: 9Polar Surface Area: 92.28Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.73CX LogP: 2.37CX LogD: 2.37Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.53Np Likeness Score: -1.77
References 1. Wu Y, Kuntz JD, Carpenter AJ, Fang J, Sauls HR, Gomez DJ, Ammala C, Xu Y, Hart S, Tadepalli S.. (2010) 2,5-Disubstituted pyridines as potent GPR119 agonists., 20 (8): [PMID:20227877 ] [10.1016/j.bmcl.2010.02.083 ]