The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Pregnen-21-ol-3,20-dione-21-(4-methylbenzenesufonate) ID: ALA1093759
PubChem CID: 14282245
Max Phase: Preclinical
Molecular Formula: C28H36O5S
Molecular Weight: 484.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(S(=O)(=O)OCC(=O)[C@H]2CC[C@H]3[C@@H]4CCC5=CC(=O)CC[C@]5(C)[C@H]4CC[C@]23C)cc1
Standard InChI: InChI=1S/C28H36O5S/c1-18-4-7-21(8-5-18)34(31,32)33-17-26(30)25-11-10-23-22-9-6-19-16-20(29)12-14-27(19,2)24(22)13-15-28(23,25)3/h4-5,7-8,16,22-25H,6,9-15,17H2,1-3H3/t22-,23-,24-,25+,27-,28-/m0/s1
Standard InChI Key: ZQPLMASYQDRTTR-DLIGHSALSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-4.6188 -10.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6188 -9.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9071 -8.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9071 -10.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1913 -10.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4754 -10.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7595 -10.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7595 -9.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0478 -8.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2632 -9.2238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2215 -8.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2635 -7.8894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1493 -7.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9735 -7.1712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0478 -8.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0478 -7.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7595 -7.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4754 -8.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4754 -8.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1913 -9.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1913 -8.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4754 -9.7917 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.7595 -8.5542 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.0478 -9.7917 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-5.3337 -10.6161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2646 -6.4607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3833 -6.4554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2073 -6.4957 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.0307 -6.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1917 -7.3205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2245 -5.6709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4484 -7.1976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2711 -7.1889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6758 -6.4707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2518 -5.7598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4305 -5.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5007 -6.4606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13 14 1 0
12 15 1 0
9 15 1 0
15 16 1 1
15 17 1 0
17 18 1 0
18 19 1 0
8 19 1 0
19 20 1 0
3 20 1 0
5 20 1 0
20 21 1 1
19 22 1 6
8 23 1 1
9 24 1 6
1 25 2 0
1 2 1 0
13 26 2 0
2 3 1 0
14 27 1 0
1 4 1 0
27 28 1 0
4 5 2 0
28 29 1 0
5 6 1 0
28 30 2 0
6 7 1 0
28 31 2 0
7 8 1 0
29 32 2 0
8 9 1 0
32 33 1 0
9 10 1 0
33 34 2 0
10 11 1 0
34 35 1 0
11 12 1 0
35 36 2 0
36 29 1 0
12 13 1 1
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.66Molecular Weight (Monoisotopic): 484.2283AlogP: 5.42#Rotatable Bonds: 5Polar Surface Area: 77.51Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.90CX LogD: 5.90Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.52Np Likeness Score: 1.11
References 1. Dexheimer TS, Gediya LK, Stephen AG, Weidlich I, Antony S, Marchand C, Interthal H, Nicklaus M, Fisher RJ, Njar VC, Pommier Y.. (2009) 4-Pregnen-21-ol-3,20-dione-21-(4-bromobenzenesulfonate) (NSC 88915) and related novel steroid derivatives as tyrosyl-DNA phosphodiesterase (Tdp1) inhibitors., 52 (22): [PMID:19883083 ] [10.1021/jm901061s ]