N,N-Dipropyl-N'-[6-(trifluoromethoxy)benzothiazol-2-yl]-acetamidine

ID: ALA1093765

PubChem CID: 44818642

Max Phase: Preclinical

Molecular Formula: C16H20F3N3OS

Molecular Weight: 359.42

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCN(CCC)/C(C)=N/c1nc2ccc(OC(F)(F)F)cc2s1

Standard InChI:  InChI=1S/C16H20F3N3OS/c1-4-8-22(9-5-2)11(3)20-15-21-13-7-6-12(10-14(13)24-15)23-16(17,18)19/h6-7,10H,4-5,8-9H2,1-3H3/b20-11+

Standard InChI Key:  JLBQGCAZDYEFIR-RGVLZGJSSA-N

Molfile:  

     RDKit          2D

 24 25  0  0  0  0  0  0  0  0999 V2000
    4.6486   -5.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6474   -4.5018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3622   -4.0890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3604   -5.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0758   -5.3328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0761   -4.5018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8665   -4.2452    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.3549   -4.9177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8661   -5.5898    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1799   -4.9180    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9326   -4.0899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9320   -3.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9250   -2.4417    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.7570   -3.2611    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.1070   -3.2670    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.5926   -4.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1803   -3.4891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4176   -4.2040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8303   -3.4896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8299   -4.9186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6553   -3.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6549   -4.9189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0671   -5.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0681   -2.7756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 11 12  1  0
  2  3  1  0
 12 13  1  0
  3  6  2  0
 12 14  1  0
  1  2  2  0
 12 15  1  0
  5  4  2  0
 10 16  2  0
  6  7  1  0
 16 17  1  0
  7  8  1  0
 16 18  1  0
  8  9  2  0
 18 19  1  0
  9  5  1  0
 18 20  1  0
  4  1  1  0
 19 21  1  0
  8 10  1  0
 20 22  1  0
  5  6  1  0
 22 23  1  0
  2 11  1  0
 21 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA1093765

    CID 44818642

Associated Targets(non-human)

Cortex (245 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 359.42Molecular Weight (Monoisotopic): 359.1279AlogP: 5.37#Rotatable Bonds: 6
Polar Surface Area: 37.72Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.55CX LogP: 5.64CX LogD: 5.59
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.51Np Likeness Score: -1.77

References

1. Anzini M, Chelini A, Mancini A, Cappelli A, Frosini M, Ricci L, Valoti M, Magistretti J, Castelli L, Giordani A, Makovec F, Vomero S..  (2010)  Synthesis and biological evaluation of amidine, guanidine, and thiourea derivatives of 2-amino(6-trifluoromethoxy)benzothiazole as neuroprotective agents potentially useful in brain diseases.,  53  (2): [PMID:19950903] [10.1021/jm901375r]

Source