The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-chloro-N-(3-(5-(2-(phenylamino)pyrimidin-4-yl)imidazo[2,1-b]thiazol-6-yl)phenyl)benzamide ID: ALA1093815
PubChem CID: 46886310
Max Phase: Preclinical
Molecular Formula: C28H19ClN6OS
Molecular Weight: 523.02
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cccc(-c2nc3sccn3c2-c2ccnc(Nc3ccccc3)n2)c1)c1ccccc1Cl
Standard InChI: InChI=1S/C28H19ClN6OS/c29-22-12-5-4-11-21(22)26(36)31-20-10-6-7-18(17-20)24-25(35-15-16-37-28(35)34-24)23-13-14-30-27(33-23)32-19-8-2-1-3-9-19/h1-17H,(H,31,36)(H,30,32,33)
Standard InChI Key: BIHMIKVTIYXXKN-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
10.8345 -2.3986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8333 -3.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5489 -3.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2658 -3.2263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2629 -2.3950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5471 -1.9856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9821 -3.6357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0692 -4.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7360 -3.2986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2895 -3.9113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8799 -4.6262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4333 -5.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1851 -4.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0960 -4.0799 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.3608 -4.8789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6404 -4.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9310 -4.8943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3724 -5.7012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6661 -6.1246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9370 -5.7218 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6806 -6.9502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9729 -7.3756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2553 -6.9727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5481 -7.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5621 -8.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2894 -8.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9937 -8.1969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5448 -1.1975 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8501 -0.7514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8891 0.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1163 -1.1300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6251 0.4490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6645 1.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9692 1.7201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2328 1.3372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1971 0.5144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3188 0.0012 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4 5 1 0
2 3 1 0
5 6 2 0
6 1 1 0
7 8 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 10 1 0
19 21 1 0
1 2 2 0
21 22 1 0
3 4 2 0
22 23 2 0
15 16 2 0
23 24 1 0
24 25 2 0
16 17 1 0
25 26 1 0
17 20 2 0
26 27 2 0
27 22 1 0
6 28 1 0
8 11 1 0
19 18 2 0
18 15 1 0
8 15 1 0
19 20 1 0
10 9 2 0
9 7 1 0
4 7 1 0
10 11 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 30 1 0
32 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.02Molecular Weight (Monoisotopic): 522.1030AlogP: 7.17#Rotatable Bonds: 6Polar Surface Area: 84.21Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.19CX Basic pKa: 2.65CX LogP: 6.67CX LogD: 6.67Aromatic Rings: 6Heavy Atoms: 37QED Weighted: 0.24Np Likeness Score: -1.99
References 1. Fidanze SD, Erickson SA, Wang GT, Mantei R, Clark RF, Sorensen BK, Bamaung NY, Kovar P, Johnson EF, Swinger KK, Stewart KD, Zhang Q, Tucker LA, Pappano WN, Wilsbacher JL, Wang J, Sheppard GS, Bell RL, Davidsen SK, Hubbard RD.. (2010) Imidazo[2,1-b]thiazoles: multitargeted inhibitors of both the insulin-like growth factor receptor and members of the epidermal growth factor family of receptor tyrosine kinases., 20 (8): [PMID:20346655 ] [10.1016/j.bmcl.2010.03.015 ]