(1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-3-yl)((3S,4s,5R)-4-hydroxy-3,5-dimethyl-4-phenylpiperidin-1-yl)methanone

ID: ALA1093846

PubChem CID: 46865980

Max Phase: Preclinical

Molecular Formula: C28H36F2N2O2

Molecular Weight: 470.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H]1CN(C(=O)C2CN(C(C)(C)C)CC2c2ccc(F)cc2F)C[C@H](C)[C@@]1(O)c1ccccc1

Standard InChI:  InChI=1S/C28H36F2N2O2/c1-18-14-31(15-19(2)28(18,34)20-9-7-6-8-10-20)26(33)24-17-32(27(3,4)5)16-23(24)22-12-11-21(29)13-25(22)30/h6-13,18-19,23-24,34H,14-17H2,1-5H3/t18-,19+,23?,24?,28-

Standard InChI Key:  WHPJOAUPIZDJNX-KPOIJUDDSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    6.5349    0.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2199    0.4070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8688    0.9165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5848    1.6911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7601    1.6600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3439    2.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7527    3.0916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5189    2.3707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0416    2.3766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8677    2.3703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2844    3.0815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8761    3.7994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0468    3.8017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6339    3.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2507   -0.4174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2752    1.6530    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.2919    4.5131    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.1038    3.0898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2824    3.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8697    2.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2847    1.6586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1123    1.6592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2792    2.9625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4500    1.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6240    1.6737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2043    0.9643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6096    0.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4389    0.2389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8548    0.9489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8689    3.8014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0667    0.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5521   -0.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9801   -0.8030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2458   -1.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  1  0
 12 17  1  0
  8 18  1  0
  3  4  1  0
  4  5  1  0
  9 10  2  0
  5  1  1  0
 10 11  1  0
  8 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
  1  2  1  0
 20 23  1  1
 11 12  2  0
 20 24  1  0
 24 25  2  0
 12 13  1  0
 25 26  1  0
  2  3  1  0
 26 27  2  0
 13 14  2  0
 27 28  1  0
 14  9  1  0
 28 29  2  0
 29 24  1  0
  4  9  1  0
 19 30  1  1
  6  7  2  0
 21 31  1  1
  2 15  1  0
 15 32  1  0
  6  8  1  0
 15 33  1  0
 10 16  1  0
 15 34  1  0
M  END

Associated Targets(Human)

MC4R Tclin Melanocortin receptor 4 (10016 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.60Molecular Weight (Monoisotopic): 470.2745AlogP: 4.78#Rotatable Bonds: 3
Polar Surface Area: 43.78Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.64CX Basic pKa: 9.05CX LogP: 4.38CX LogD: 2.73
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.70Np Likeness Score: -0.42

References

1. Lansdell MI, Hepworth D, Calabrese A, Brown AD, Blagg J, Burring DJ, Wilson P, Fradet D, Brown TB, Quinton F, Mistry N, Tang K, Mount N, Stacey P, Edmunds N, Adams C, Gaboardi S, Neal-Morgan S, Wayman C, Cole S, Phipps J, Lewis M, Verrier H, Gillon V, Feeder N, Heatherington A, Sultana S, Haughie S, Martin SW, Sudworth M, Tweedy S..  (2010)  Discovery of a selective small-molecule melanocortin-4 receptor agonist with efficacy in a pilot study of sexual dysfunction in humans.,  53  (8): [PMID:20329799] [10.1021/jm9017866]

Source