1-(4-(1H-imidazol-1-yl)benzyl)-5-hydroxy-4-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylic acid

ID: ALA1093880

PubChem CID: 46886381

Max Phase: Preclinical

Molecular Formula: C20H19N3O4

Molecular Weight: 365.39

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cn(Cc2ccc(-n3ccnc3)cc2)c2c(c1=O)C(O)CCC2

Standard InChI:  InChI=1S/C20H19N3O4/c24-17-3-1-2-16-18(17)19(25)15(20(26)27)11-23(16)10-13-4-6-14(7-5-13)22-9-8-21-12-22/h4-9,11-12,17,24H,1-3,10H2,(H,26,27)

Standard InChI Key:  MEJNGKCNDXJOBP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   14.0279   -9.8180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0267  -10.6452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7414  -11.0579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7396   -9.4053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4547   -9.8144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4535  -10.6472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1702  -11.0623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8927  -10.6493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8939   -9.8164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1726   -9.3967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1679  -11.8871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8810  -12.3015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1727   -8.5720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6093   -9.4052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3226   -9.8193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6113   -8.5805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8734  -13.1265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5857  -13.5408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3021  -13.1304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3018  -12.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5889  -11.8908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0135  -13.5422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7371   -8.5806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0104  -14.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7901  -14.6228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2796  -13.9621    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8024  -13.2925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 10 13  2  0
  3  6  1  0
  1  2  1  0
  5  4  1  0
 14 15  1  0
 14 16  2  0
  9 14  1  0
  4  1  1  0
 12 17  2  0
  5 10  1  0
 17 18  1  0
  6  7  1  0
 18 19  2  0
  7  8  1  0
 19 20  1  0
  8  9  2  0
 20 21  2  0
 21 12  1  0
  9 10  1  0
 19 22  1  0
  5  6  2  0
  4 23  1  0
 22 24  1  0
  7 11  1  0
 11 12  1  0
  2  3  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
M  END

Associated Targets(Human)

CHRM1 Tclin Muscarinic acetylcholine receptor M1 (12690 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Plasma (10718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 365.39Molecular Weight (Monoisotopic): 365.1376AlogP: 2.15#Rotatable Bonds: 4
Polar Surface Area: 97.35Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.85CX Basic pKa: 6.06CX LogP: 0.78CX LogD: -0.55
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.74Np Likeness Score: -0.88

References

1. Kuduk SD, DiPardo RM, Beshore DC, Ray WJ, Ma L, Wittmann M, Seager MA, Koeplinger KA, Thompson CD, Hartman GD, Bilodeau MT..  (2010)  Hydroxy cycloalkyl fused pyridone carboxylic acid M(1) positive allosteric modulators.,  20  (8): [PMID:20346667] [10.1016/j.bmcl.2010.02.095]

Source