The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(1H-imidazol-1-yl)benzyl)-5-hydroxy-4-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylic acid ID: ALA1093880
PubChem CID: 46886381
Max Phase: Preclinical
Molecular Formula: C20H19N3O4
Molecular Weight: 365.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cn(Cc2ccc(-n3ccnc3)cc2)c2c(c1=O)C(O)CCC2
Standard InChI: InChI=1S/C20H19N3O4/c24-17-3-1-2-16-18(17)19(25)15(20(26)27)11-23(16)10-13-4-6-14(7-5-13)22-9-8-21-12-22/h4-9,11-12,17,24H,1-3,10H2,(H,26,27)
Standard InChI Key: MEJNGKCNDXJOBP-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 30 0 0 0 0 0 0 0 0999 V2000
14.0279 -9.8180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0267 -10.6452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7414 -11.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7396 -9.4053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4547 -9.8144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4535 -10.6472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1702 -11.0623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8927 -10.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8939 -9.8164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1726 -9.3967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1679 -11.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8810 -12.3015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1727 -8.5720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6093 -9.4052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3226 -9.8193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6113 -8.5805 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8734 -13.1265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5857 -13.5408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3021 -13.1304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3018 -12.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5889 -11.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0135 -13.5422 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7371 -8.5806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0104 -14.3615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7901 -14.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2796 -13.9621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8024 -13.2925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 13 2 0
3 6 1 0
1 2 1 0
5 4 1 0
14 15 1 0
14 16 2 0
9 14 1 0
4 1 1 0
12 17 2 0
5 10 1 0
17 18 1 0
6 7 1 0
18 19 2 0
7 8 1 0
19 20 1 0
8 9 2 0
20 21 2 0
21 12 1 0
9 10 1 0
19 22 1 0
5 6 2 0
4 23 1 0
22 24 1 0
7 11 1 0
11 12 1 0
2 3 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 365.39Molecular Weight (Monoisotopic): 365.1376AlogP: 2.15#Rotatable Bonds: 4Polar Surface Area: 97.35Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.85CX Basic pKa: 6.06CX LogP: 0.78CX LogD: -0.55Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.74Np Likeness Score: -0.88
References 1. Kuduk SD, DiPardo RM, Beshore DC, Ray WJ, Ma L, Wittmann M, Seager MA, Koeplinger KA, Thompson CD, Hartman GD, Bilodeau MT.. (2010) Hydroxy cycloalkyl fused pyridone carboxylic acid M(1) positive allosteric modulators., 20 (8): [PMID:20346667 ] [10.1016/j.bmcl.2010.02.095 ]