The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-amino-N-((5-chloro-2-(3-methoxypropyl)pyridin-4-yl)methyl)-N-cyclopropyl-2-(4-(3-(2,6-dichloro-4-methylphenoxy)propyl)benzyl)propanamide ID: ALA1093935
PubChem CID: 46883847
Max Phase: Preclinical
Molecular Formula: C33H40Cl3N3O3
Molecular Weight: 633.06
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COCCCc1cc(CN(C(=O)C(CN)Cc2ccc(CCCOc3c(Cl)cc(C)cc3Cl)cc2)C2CC2)c(Cl)cn1
Standard InChI: InChI=1S/C33H40Cl3N3O3/c1-22-15-29(34)32(30(35)16-22)42-14-3-5-23-7-9-24(10-8-23)17-25(19-37)33(40)39(28-11-12-28)21-26-18-27(6-4-13-41-2)38-20-31(26)36/h7-10,15-16,18,20,25,28H,3-6,11-14,17,19,21,37H2,1-2H3
Standard InChI Key: GZPYZOSKISZVND-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
11.9517 0.6462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9505 -0.1813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6680 -0.5942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3828 -0.1808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3796 0.6503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6661 1.0591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6633 1.8841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3746 2.2989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0931 1.8888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8043 2.3036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5229 1.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5234 1.0713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2364 0.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9487 1.0761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9431 1.9059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2294 2.3118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2224 3.1368 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.8070 0.6576 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.6678 -1.4192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3803 -1.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0976 -1.4197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8101 -1.8323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0978 -0.5947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8098 -2.6573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5228 -1.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2397 -1.8327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2354 -2.6550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9470 -3.0676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6653 -2.6552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6627 -1.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9459 -1.4170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9413 -0.5920 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.4011 -3.3707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2261 -3.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3801 -2.6569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6674 -3.0692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9464 -3.8926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2335 -4.3045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6679 0.6670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2328 -5.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5199 -5.5414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8030 -5.1283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 10 1 0
20 21 1 0
2 3 1 0
21 22 1 0
10 11 1 0
21 23 2 0
5 6 2 0
22 24 1 0
11 12 2 0
22 25 1 0
6 1 1 0
25 26 1 0
12 13 1 0
26 27 2 0
1 2 2 0
27 28 1 0
13 14 2 0
28 29 2 0
6 7 1 0
29 30 1 0
14 15 1 0
30 31 2 0
31 26 1 0
3 4 2 0
31 32 1 0
33 24 1 0
34 33 1 0
24 34 1 0
15 16 2 0
16 11 1 0
7 8 1 0
20 35 1 0
16 17 1 0
35 36 1 0
28 37 1 0
12 18 1 0
37 38 1 0
38 40 1 0
8 9 1 0
14 39 1 0
3 19 1 0
40 41 1 0
4 5 1 0
19 20 1 0
41 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 633.06Molecular Weight (Monoisotopic): 631.2135AlogP: 7.25#Rotatable Bonds: 16Polar Surface Area: 77.68Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.97CX LogP: 6.93CX LogD: 5.36Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.17Np Likeness Score: -0.78
References 1. Chen A, Bayly C, Bezençon O, Richard-Bildstein S, Dubé D, Dubé L, Gagné S, Gallant M, Gaudreault M, Grimm E, Houle R, Lacombe P, Laliberté S, Lévesque JF, Liu S, MacDonald D, Mackay B, Martin D, McKay D, Powell D, Remen L, Soisson S, Toulmond S.. (2010) Design and optimization of a substituted amino propanamide series of renin inhibitors for the treatment of hypertension., 20 (7): [PMID:20206513 ] [10.1016/j.bmcl.2010.02.036 ]