(3S)-4-[((3-Amino-3-carboxy)propyl)(hydroxy)phosphinyl]-4-hydroxy-3-methyl-2-butenoic Acid

ID: ALA1093965

PubChem CID: 24779947

Max Phase: Preclinical

Molecular Formula: C9H16NO7P

Molecular Weight: 281.20

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C/C(=C\C(=O)O)C(O)P(=O)(O)CC[C@H](N)C(=O)O

Standard InChI:  InChI=1S/C9H16NO7P/c1-5(4-7(11)12)9(15)18(16,17)3-2-6(10)8(13)14/h4,6,9,15H,2-3,10H2,1H3,(H,11,12)(H,13,14)(H,16,17)/b5-4+/t6-,9?/m0/s1

Standard InChI Key:  GRQUVPKMXUGCRO-NVKMXGOXSA-N

Molfile:  

     RDKit          2D

 18 17  0  0  0  0  0  0  0  0999 V2000
   -3.0526    1.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3381    2.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6236    1.5950    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9091    2.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6236    0.7700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6317    2.4247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7670    2.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4815    1.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1961    2.0075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4815    0.7700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7670    2.8326    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1946    1.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9091    2.8326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1946    0.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5199    2.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2343    1.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9488    2.0075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2343    0.7700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  5  1  0
  8 10  2  0
  2  3  1  0
  7 11  1  1
  3  6  2  0
  4 12  1  0
  1  2  1  0
  4 13  1  0
  1  7  1  0
 12 14  1  0
  3  4  1  0
 12 15  2  0
  7  8  1  0
 15 16  1  0
 16 17  1  0
  8  9  1  0
 16 18  2  0
M  END

Associated Targets(non-human)

Grm4 Metabotropic glutamate receptor 4 (663 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 281.20Molecular Weight (Monoisotopic): 281.0664AlogP: -0.59#Rotatable Bonds: 7
Polar Surface Area: 158.15Molecular Species: ZWITTERIONHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 1.14CX Basic pKa: 9.53CX LogP: -3.18CX LogD: -9.36
Aromatic Rings: Heavy Atoms: 18QED Weighted: 0.31Np Likeness Score: 1.10

References

1. Selvam C, Oueslati N, Lemasson IA, Brabet I, Rigault D, Courtiol T, Cesarini S, Triballeau N, Bertrand HO, Goudet C, Pin JP, Acher FC..  (2010)  A virtual screening hit reveals new possibilities for developing group III metabotropic glutamate receptor agonists.,  53  (7): [PMID:20218620] [10.1021/jm901523t]

Source