The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-((5-(amino(iminio)methylamino)pentyl)(((2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl)amino)-2-ammoniobutanoate chloride ID: ALA1093966
PubChem CID: 46884804
Max Phase: Preclinical
Molecular Formula: C20H35ClN10O5
Molecular Weight: 494.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cl.N=C(N)NCCCCCN(CC[C@H](N)C(=O)O)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O
Standard InChI: InChI=1S/C20H34N10O5.ClH/c21-11(19(33)34)4-7-29(6-3-1-2-5-25-20(23)24)8-12-14(31)15(32)18(35-12)30-10-28-13-16(22)26-9-27-17(13)30;/h9-12,14-15,18,31-32H,1-8,21H2,(H,33,34)(H2,22,26,27)(H4,23,24,25);1H/t11-,12+,14+,15+,18+;/m0./s1
Standard InChI Key: LJQFCIXUZOFNFG-CPQMNCBCSA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
14.1250 -11.3125 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
13.3114 -9.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6046 -10.1674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6169 -10.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9100 -11.4136 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9224 -12.2426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2113 -12.6638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6416 -12.6423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2970 -8.9376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0130 -7.7460 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8576 -7.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1884 -7.1127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5234 -7.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6435 -7.3480 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7370 -7.3472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5989 -8.3848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7739 -8.3848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5211 -9.1705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8556 -9.1705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7287 -6.5604 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8996 -6.5594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9804 -7.3465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3124 -7.8298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3992 -8.6482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1496 -8.9844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8178 -8.4960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7317 -7.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3981 -7.1928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3067 -7.3198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5828 -7.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8765 -7.2964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1566 -7.6992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8900 -6.4715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4456 -7.2760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1385 -8.5271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9972 -8.5506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14 23 1 0
3 4 1 0
6 7 1 0
22 20 1 0
20 21 2 0
21 14 1 0
16 11 1 0
11 12 1 0
22 23 2 0
12 13 1 0
23 24 1 0
13 17 1 0
24 25 2 0
2 3 1 0
25 26 1 0
11 14 1 1
26 27 2 0
27 22 1 0
6 8 2 0
27 28 1 0
15 10 1 0
13 15 1 1
10 29 1 0
16 17 1 0
29 30 1 0
4 5 1 0
30 31 1 0
2 9 1 0
31 32 1 0
31 33 1 1
5 6 1 0
17 18 1 6
32 34 1 0
32 35 2 0
16 19 1 6
10 36 1 0
36 9 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.56Molecular Weight (Monoisotopic): 494.2714AlogP: -2.21#Rotatable Bonds: 13Polar Surface Area: 247.77Molecular Species: ZWITTERIONHBA: 12HBD: 8#RO5 Violations: 2HBA (Lipinski): 15HBD (Lipinski): 11#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.81CX Basic pKa: 11.90CX LogP: -4.23CX LogD: -6.26Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.08Np Likeness Score: 0.60
References 1. Dowden J, Hong W, Parry RV, Pike RA, Ward SG.. (2010) Toward the development of potent and selective bisubstrate inhibitors of protein arginine methyltransferases., 20 (7): [PMID:20219369 ] [10.1016/j.bmcl.2010.02.069 ]