The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-(2-(4-fluorophenyl)-5-(4-methoxybenzyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)-N-propylpyrimidin-2-amine ID: ALA1094013
PubChem CID: 46884198
Max Phase: Preclinical
Molecular Formula: C27H28FN5O
Molecular Weight: 457.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCNc1nccc(-c2c(-c3ccc(F)cc3)nc3n2[C@H](Cc2ccc(OC)cc2)CC3)n1
Standard InChI: InChI=1S/C27H28FN5O/c1-3-15-29-27-30-16-14-23(31-27)26-25(19-6-8-20(28)9-7-19)32-24-13-10-21(33(24)26)17-18-4-11-22(34-2)12-5-18/h4-9,11-12,14,16,21H,3,10,13,15,17H2,1-2H3,(H,29,30,31)/t21-/m0/s1
Standard InChI Key: XTEXFYJKENTXMP-NRFANRHFSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
9.2532 -8.3512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2519 -9.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9663 -9.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6826 -9.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6794 -8.3471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9643 -7.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5344 -7.9361 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.3972 -9.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3833 -10.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1889 -9.3442 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6635 -10.8101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9584 -10.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2360 -10.7761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2174 -11.6029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9278 -12.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6516 -11.6323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6624 -10.0199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1707 -10.6780 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6450 -11.3532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4319 -11.1073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4420 -10.2849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2422 -12.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6608 -12.7812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9175 -12.8550 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1960 -13.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4850 -12.8338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7636 -13.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2519 -13.4981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6742 -14.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5011 -14.2030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9037 -13.4790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4833 -12.7687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9208 -14.9119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5143 -15.6311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16 11 1 0
9 11 1 0
17 18 1 0
4 8 1 0
8 9 2 0
4 5 1 0
9 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 17 1 0
17 10 2 0
19 22 1 1
10 8 1 0
22 23 1 0
2 3 1 0
15 24 1 0
5 6 2 0
24 25 1 0
11 12 2 0
25 26 1 0
6 1 1 0
26 27 1 0
12 13 1 0
23 28 2 0
1 2 2 0
28 29 1 0
13 14 2 0
29 30 2 0
1 7 1 0
30 31 1 0
14 15 1 0
31 32 2 0
32 23 1 0
3 4 2 0
30 33 1 0
15 16 2 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.55Molecular Weight (Monoisotopic): 457.2278AlogP: 5.71#Rotatable Bonds: 8Polar Surface Area: 64.86Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.87CX LogP: 5.58CX LogD: 5.58Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.37Np Likeness Score: -1.01
References 1. Siddiqui MA, Reddy PA.. (2010) Small molecule JNK (c-Jun N-terminal kinase) inhibitors., 53 (8): [PMID:20146479 ] [10.1021/jm9003279 ]