(2R*,3S*,4R*,6S*)-6-((Ethylthio)methyl)tetrahydro-2,3,4-triphenyl-2H-pyran-4-ol

ID: ALA1094097

PubChem CID: 46220728

Max Phase: Preclinical

Molecular Formula: C26H28O2S

Molecular Weight: 404.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCSC[C@@H]1C[C@](O)(c2ccccc2)[C@@H](c2ccccc2)[C@H](c2ccccc2)O1

Standard InChI:  InChI=1S/C26H28O2S/c1-2-29-19-23-18-26(27,22-16-10-5-11-17-22)24(20-12-6-3-7-13-20)25(28-23)21-14-8-4-9-15-21/h3-17,23-25,27H,2,18-19H2,1H3/t23-,24-,25-,26-/m0/s1

Standard InChI Key:  UPTSZZUOIGQJNC-CQJMVLFOSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   12.4792    1.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4792    0.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1912    0.4833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9032    0.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9032    1.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1912    2.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7708    2.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1843    3.5719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7646    4.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9329    4.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5226    3.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9447    2.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5958    2.8500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7663    0.4776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6171    0.4781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3321    0.8896    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.0460    0.4761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7611    0.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0528    0.8899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3404    0.4765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3420   -0.3488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0621   -0.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7715   -0.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7659    2.1291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7648    2.9552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0500    3.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3358    2.9509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3408    2.1216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0562    1.7151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2 14  1  1
  6  7  1  0
  4 15  1  1
  1  2  1  0
 15 16  1  0
  7  8  2  0
 16 17  1  0
  1  6  1  0
 17 18  1  0
  8  9  1  0
 14 19  2  0
  2  3  1  0
 19 20  1  0
  9 10  2  0
 20 21  2  0
  3  4  1  0
 21 22  1  0
 10 11  1  0
 22 23  2  0
 23 14  1  0
  4  5  1  0
 11 12  2  0
 24 25  2  0
 12  7  1  0
 25 26  1  0
  5  6  1  0
 26 27  2  0
  6 13  1  6
 27 28  1  0
 28 29  2  0
 29 24  1  0
  1 24  1  6
M  END

Associated Targets(non-human)

PTGS2 Cyclooxygenase-2 (1953 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTGS1 Cyclooxygenase-1 (5266 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 404.58Molecular Weight (Monoisotopic): 404.1810AlogP: 5.94#Rotatable Bonds: 6
Polar Surface Area: 29.46Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.60CX Basic pKa: CX LogP: 5.59CX LogD: 5.59
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.55Np Likeness Score: 0.42

References

1. Singh P, Bhardwaj A..  (2010)  Mono-, di-, and triaryl substituted tetrahydropyrans as cyclooxygenase-2 and tumor growth inhibitors. Synthesis and biological evaluation.,  53  (9): [PMID:20387815] [10.1021/jm1001327]

Source