The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Cimicifugic acid N ID: ALA1094303
PubChem CID: 46210734
Max Phase: Preclinical
Molecular Formula: C22H22O11
Molecular Weight: 462.41
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Cimicifugic Acid N | Cimicifugic acid N|CHEMBL1094303|BDBM50316417
Canonical SMILES: COc1ccc(/C=C\C(=O)O[C@H](C(=O)O)[C@](O)(Cc2ccc(O)c(O)c2)C(=O)O)cc1OC
Standard InChI: InChI=1S/C22H22O11/c1-31-16-7-4-12(10-17(16)32-2)5-8-18(25)33-19(20(26)27)22(30,21(28)29)11-13-3-6-14(23)15(24)9-13/h3-10,19,23-24,30H,11H2,1-2H3,(H,26,27)(H,28,29)/b8-5-/t19-,22-/m1/s1
Standard InChI Key: YMPYAGUNPNITIL-SAEXZTQASA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
-3.1139 -17.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1151 -18.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4003 -18.4902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6838 -18.0769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6867 -17.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4021 -16.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9738 -16.8311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2587 -17.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4552 -16.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8458 -17.8208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1449 -17.9572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2751 -18.6673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9698 -17.9658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1712 -17.2356 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4523 -16.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1653 -15.5858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2636 -15.5908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8841 -16.8204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6001 -17.2302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8810 -15.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8285 -16.8376 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8299 -18.4893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3130 -16.8150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3099 -15.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0238 -15.5793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0210 -14.7550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3045 -14.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5892 -14.7640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5955 -15.5869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3003 -13.5194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0126 -13.1033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7341 -14.3402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4500 -14.7504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 8 1 0
15 17 1 0
14 18 1 0
8 9 1 0
18 19 1 0
4 5 1 0
18 20 2 0
8 10 1 6
1 21 1 0
2 3 1 0
2 22 1 0
8 11 1 0
19 23 2 0
5 6 2 0
23 24 1 0
11 12 2 0
24 25 2 0
6 1 1 0
25 26 1 0
11 13 1 0
26 27 2 0
1 2 2 0
27 28 1 0
9 14 1 0
28 29 2 0
29 24 1 0
5 7 1 0
27 30 1 0
9 15 1 1
30 31 1 0
3 4 2 0
26 32 1 0
15 16 2 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.41Molecular Weight (Monoisotopic): 462.1162AlogP: 1.18#Rotatable Bonds: 10Polar Surface Area: 180.05Molecular Species: ACIDHBA: 9HBD: 5#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 2.98CX Basic pKa: ┄CX LogP: 2.37CX LogD: -4.00Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.19Np Likeness Score: 1.15
References 1. Iwanaga A, Kusano G, Warashina T, Miyase T.. (2010) Phenolic constituents of the aerial parts of Cimicifuga simplex and Cimicifuga japonica., 73 (4): [PMID:20184336 ] [10.1021/np900752t ]