The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-{[(2S)-2-Amino-4-methylpentyl]oxy}pyridin-3-yl)-8,9-dimethoxybenzo[c]-2,7-naphthyridin-4-amine ID: ALA1094321
PubChem CID: 46192859
Max Phase: Preclinical
Molecular Formula: C25H29N5O3
Molecular Weight: 447.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2ncc3c(N)nc(-c4cncc(OC[C@@H](N)CC(C)C)c4)cc3c2cc1OC
Standard InChI: InChI=1S/C25H29N5O3/c1-14(2)5-16(26)13-33-17-6-15(10-28-11-17)21-7-18-19-8-23(31-3)24(32-4)9-22(19)29-12-20(18)25(27)30-21/h6-12,14,16H,5,13,26H2,1-4H3,(H2,27,30)/t16-/m0/s1
Standard InChI Key: YPVWKNICBVIRFI-INIZCTEOSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-4.1583 -27.2867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1596 -28.1143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4467 -28.5271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4486 -26.8740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7305 -27.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7315 -28.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0140 -28.5316 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2911 -28.1178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0122 -26.8645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2892 -27.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5652 -26.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5581 -26.0381 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2811 -25.6150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0113 -26.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1462 -27.2928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2754 -24.7901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5538 -24.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5478 -23.5576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2599 -23.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9795 -23.5515 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9819 -24.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1696 -23.1503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8810 -23.5681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5984 -23.1608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3098 -23.5785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6044 -22.3360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.8730 -26.8748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.5871 -27.2880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8746 -28.5257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.5884 -28.1122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0272 -23.1713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7386 -23.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0332 -22.3464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 9 1 0
13 16 1 0
6 7 1 0
16 17 2 0
7 8 2 0
17 18 1 0
8 10 1 0
18 19 2 0
9 10 2 0
19 20 1 0
5 4 2 0
20 21 2 0
21 16 1 0
4 1 1 0
18 22 1 0
5 6 1 0
22 23 1 0
23 24 1 0
2 3 1 0
24 25 1 1
3 6 2 0
24 26 1 0
9 14 1 0
1 27 1 0
10 11 1 0
27 28 1 0
11 12 2 0
2 29 1 0
12 13 1 0
29 30 1 0
13 14 2 0
25 31 1 0
1 2 2 0
31 32 1 0
11 15 1 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.54Molecular Weight (Monoisotopic): 447.2270AlogP: 4.20#Rotatable Bonds: 8Polar Surface Area: 118.40Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.55CX LogP: 2.88CX LogD: 0.76Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.39Np Likeness Score: -0.39
References 1. Nittoli T, Dushin RG, Ingalls C, Cheung K, Floyd MB, Fraser H, Olland A, Hu Y, Grosu G, Han X, Arndt K, Guo B, Wissner A.. (2010) The identification of 8,9-dimethoxy-5-(2-aminoalkoxy-pyridin-3-yl)-benzo[c][2,7]naphthyridin-4-ylamines as potent inhibitors of 3-phosphoinositide-dependent kinase-1 (PDK-1)., 45 (4): [PMID:20074837 ] [10.1016/j.ejmech.2009.12.036 ]