4-{3-[6-(3-Benzo[1,3]dioxol-5-yl-5-pyrimidin-5-yl-phenoxy)-hexyl]-2-(2-carboxy-ethyl)-phenoxy}-butyric acid

ID: ALA1094347

PubChem CID: 25192176

Max Phase: Preclinical

Molecular Formula: C36H38N2O8

Molecular Weight: 626.71

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3cncnc3)cc(-c3ccc4c(c3)OCO4)c2)c1CCC(=O)O

Standard InChI:  InChI=1S/C36H38N2O8/c39-35(40)10-6-16-44-32-9-5-8-25(31(32)12-14-36(41)42)7-3-1-2-4-15-43-30-18-27(17-28(19-30)29-21-37-23-38-22-29)26-11-13-33-34(20-26)46-24-45-33/h5,8-9,11,13,17-23H,1-4,6-7,10,12,14-16,24H2,(H,39,40)(H,41,42)

Standard InChI Key:  FRDONAYSGBGPJH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 46 50  0  0  0  0  0  0  0  0999 V2000
    8.1569   -7.1041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1557   -7.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8706   -8.3444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5870   -7.9310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5841   -7.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8688   -6.6914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3021   -8.3424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0159   -7.9288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7311   -8.3402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4449   -7.9265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1600   -8.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8738   -7.9243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1613   -9.1629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8704   -9.1694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5847   -9.5820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5845  -10.4070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2989  -10.8197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8700  -10.8194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4409   -8.3434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7268   -7.9304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0120   -8.3423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2979   -7.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5831   -8.3412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8689   -7.9281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1541   -8.3400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4400   -7.9270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4417   -7.1029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0146   -7.9311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7285   -8.3404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0126   -7.1019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7293   -6.6915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7288   -5.8712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3040   -8.3488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4119   -7.9365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4023   -9.5865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3076   -9.1704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1229   -9.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1250   -8.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9152   -8.0915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4015   -8.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9118   -9.4347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4408   -5.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4407   -4.6427    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7295   -4.2321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0169   -4.6471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0206   -5.4654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 22 23  1  0
  5  6  2  0
 23 24  1  0
 11 12  1  0
 24 25  1  0
  6  1  1  0
 25 26  1  0
 11 13  2  0
 26 27  2  0
 27 31  1  0
  1  2  2  0
 30 28  1  0
  3 14  1  0
 28 29  2  0
 29 26  1  0
  4  7  1  0
 14 15  1  0
 30 31  2  0
  3  4  2  0
 31 32  1  0
 15 16  1  0
  7  8  1  0
 33 34  2  0
 34 38  1  0
 16 17  1  0
 37 35  1  0
 35 36  2  0
 36 33  1  0
 28 33  1  0
 37 38  2  0
 16 18  2  0
  8  9  1  0
  2 19  1  0
  4  5  1  0
 19 20  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 37  1  0
  9 10  1  0
 32 42  2  0
 20 21  1  0
 42 43  1  0
  2  3  1  0
 43 44  2  0
 21 22  1  0
 44 45  1  0
 10 11  1  0
 45 46  2  0
 46 32  1  0
M  END

Associated Targets(Human)

LTB4R Tchem Leukotriene B4 receptor 1 (1083 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 626.71Molecular Weight (Monoisotopic): 626.2628AlogP: 6.98#Rotatable Bonds: 18
Polar Surface Area: 137.30Molecular Species: ACIDHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.12CX Basic pKa: 1.24CX LogP: 6.53CX LogD: 0.81
Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.11Np Likeness Score: -0.16

References

1. Goodnow RA, Hicks A, Sidduri A, Kowalczyk A, Dominique R, Qiao Q, Lou JP, Gillespie P, Fotouhi N, Tilley J, Cohen N, Choudhry S, Cavallo G, Tannu SA, Ventre JD, Lavelle D, Tare NS, Oh H, Lamb M, Kurylko G, Hamid R, Wright MB, Pamidimukkala A, Egan T, Gubler U, Hoffman AF, Wei X, Li YL, O'Neil J, Marcano R, Pozzani K, Molinaro T, Santiago J, Singer L, Hargaden M, Moore D, Catala AR, Chao LC, Hermann G, Venkat R, Mancebo H, Renzetti LM..  (2010)  Discovery of novel and potent leukotriene B4 receptor antagonists. Part 1.,  53  (9): [PMID:20380377] [10.1021/jm1001919]

Source