The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-{3-[6-(3-Benzo[1,3]dioxol-5-yl-5-pyrimidin-5-yl-phenoxy)-hexyl]-2-(2-carboxy-ethyl)-phenoxy}-butyric acid ID: ALA1094347
PubChem CID: 25192176
Max Phase: Preclinical
Molecular Formula: C36H38N2O8
Molecular Weight: 626.71
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3cncnc3)cc(-c3ccc4c(c3)OCO4)c2)c1CCC(=O)O
Standard InChI: InChI=1S/C36H38N2O8/c39-35(40)10-6-16-44-32-9-5-8-25(31(32)12-14-36(41)42)7-3-1-2-4-15-43-30-18-27(17-28(19-30)29-21-37-23-38-22-29)26-11-13-33-34(20-26)46-24-45-33/h5,8-9,11,13,17-23H,1-4,6-7,10,12,14-16,24H2,(H,39,40)(H,41,42)
Standard InChI Key: FRDONAYSGBGPJH-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 50 0 0 0 0 0 0 0 0999 V2000
8.1569 -7.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1557 -7.9315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8706 -8.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5870 -7.9310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5841 -7.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8688 -6.6914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3021 -8.3424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0159 -7.9288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7311 -8.3402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4449 -7.9265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1600 -8.3379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8738 -7.9243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1613 -9.1629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8704 -9.1694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5847 -9.5820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5845 -10.4070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2989 -10.8197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8700 -10.8194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4409 -8.3434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7268 -7.9304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0120 -8.3423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2979 -7.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5831 -8.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8689 -7.9281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1541 -8.3400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4400 -7.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4417 -7.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0146 -7.9311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7285 -8.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0126 -7.1019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7293 -6.6915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7288 -5.8712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3040 -8.3488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4119 -7.9365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4023 -9.5865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3076 -9.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1229 -9.1762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1250 -8.3460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9152 -8.0915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4015 -8.7644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9118 -9.4347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4408 -5.4623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4407 -4.6427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7295 -4.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0169 -4.6471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0206 -5.4654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22 23 1 0
5 6 2 0
23 24 1 0
11 12 1 0
24 25 1 0
6 1 1 0
25 26 1 0
11 13 2 0
26 27 2 0
27 31 1 0
1 2 2 0
30 28 1 0
3 14 1 0
28 29 2 0
29 26 1 0
4 7 1 0
14 15 1 0
30 31 2 0
3 4 2 0
31 32 1 0
15 16 1 0
7 8 1 0
33 34 2 0
34 38 1 0
16 17 1 0
37 35 1 0
35 36 2 0
36 33 1 0
28 33 1 0
37 38 2 0
16 18 2 0
8 9 1 0
2 19 1 0
4 5 1 0
19 20 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 37 1 0
9 10 1 0
32 42 2 0
20 21 1 0
42 43 1 0
2 3 1 0
43 44 2 0
21 22 1 0
44 45 1 0
10 11 1 0
45 46 2 0
46 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 626.71Molecular Weight (Monoisotopic): 626.2628AlogP: 6.98#Rotatable Bonds: 18Polar Surface Area: 137.30Molecular Species: ACIDHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.12CX Basic pKa: 1.24CX LogP: 6.53CX LogD: 0.81Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.11Np Likeness Score: -0.16
References 1. Goodnow RA, Hicks A, Sidduri A, Kowalczyk A, Dominique R, Qiao Q, Lou JP, Gillespie P, Fotouhi N, Tilley J, Cohen N, Choudhry S, Cavallo G, Tannu SA, Ventre JD, Lavelle D, Tare NS, Oh H, Lamb M, Kurylko G, Hamid R, Wright MB, Pamidimukkala A, Egan T, Gubler U, Hoffman AF, Wei X, Li YL, O'Neil J, Marcano R, Pozzani K, Molinaro T, Santiago J, Singer L, Hargaden M, Moore D, Catala AR, Chao LC, Hermann G, Venkat R, Mancebo H, Renzetti LM.. (2010) Discovery of novel and potent leukotriene B4 receptor antagonists. Part 1., 53 (9): [PMID:20380377 ] [10.1021/jm1001919 ]