(-)-(S)-1',6,6',7,7'-Hexahydroxy-3,3'-dimethyl-N5-((S)-2-phenylpropyl)-N5'-((S)-2-phenylpropyl)-2,2'-binaphthyl-5,5'-dicarboxamide

ID: ALA1094366

PubChem CID: 46236926

Max Phase: Preclinical

Molecular Formula: C42H40N2O8

Molecular Weight: 700.79

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc2c(C(=O)NC[C@@H](C)c3ccccc3)c(O)c(O)cc2c(O)c1-c1c(C)cc2c(C(=O)NC[C@@H](C)c3ccccc3)c(O)c(O)cc2c1O

Standard InChI:  InChI=1S/C42H40N2O8/c1-21-15-27-29(17-31(45)39(49)35(27)41(51)43-19-23(3)25-11-7-5-8-12-25)37(47)33(21)34-22(2)16-28-30(38(34)48)18-32(46)40(50)36(28)42(52)44-20-24(4)26-13-9-6-10-14-26/h5-18,23-24,45-50H,19-20H2,1-4H3,(H,43,51)(H,44,52)/t23-,24-/m1/s1

Standard InChI Key:  RAYNZUHYMMLQQA-DNQXCXABSA-N

Molfile:  

     RDKit          2D

 52 57  0  0  0  0  0  0  0  0999 V2000
   -2.0458   -6.8958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7208   -6.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2458   -6.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4208   -6.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8958   -6.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2208   -6.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8125   -6.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4708   -6.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6500   -6.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0042   -6.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0167   -7.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6625   -7.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4625   -6.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1250   -6.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4875   -7.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8083   -7.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4500   -7.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1417   -7.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8750   -5.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2292   -5.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0583   -5.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6958   -5.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2750   -7.6167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9667   -7.5375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7375   -8.2667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0333   -8.3208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6833   -8.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3875   -8.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4125   -5.4500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2292   -5.4417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9167   -9.0583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6375   -8.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2125   -8.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5083   -8.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2875   -6.1958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9500   -6.1042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0958   -4.6833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4792   -4.7583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4333   -8.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2583   -8.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7417   -9.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4958   -9.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2292   -9.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4583   -8.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9250   -7.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6167   -7.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1500   -9.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6500  -10.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8792   -9.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9083  -10.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7333  -10.4958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4750  -10.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  5  1  0
  3  4  1  0
  4 11  1  0
  5  8  1  0
  6  1  2  0
  7  6  1  0
  8  9  2  0
  9  3  1  0
 10  7  1  0
 11 16  2  0
 12  3  2  0
 13  1  1  0
 14 22  1  0
 15 12  1  0
 16  6  1  0
 17  1  1  0
 18  2  1  0
 19  8  1  0
 20 21  1  0
 21 13  2  0
 22 19  2  0
 23 17  1  0
 24 18  1  0
 25 18  2  0
 26 17  2  0
 27 23  1  0
 28 24  1  0
 29 10  1  0
 30  9  1  0
 31 34  1  0
 32 33  1  0
 33 28  1  0
 34 27  1  0
 35 13  1  0
 36 14  1  0
 37 22  1  0
 38 21  1  0
 39 11  1  0
 40 12  1  0
 41 31  2  0
 42 31  1  0
 43 32  2  0
 44 32  1  0
 34 45  1  6
 33 46  1  1
 47 41  1  0
 48 43  1  0
 49 44  2  0
 50 42  2  0
 51 47  2  0
 52 49  1  0
 20  7  2  0
 10  4  2  0
  5 15  2  0
 50 51  1  0
 14  2  2  0
 52 48  2  0
M  END

Associated Targets(Human)

NCI-H460 (60772 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PC-3 (62116 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BCL2L1 Tchem Apoptosis regulator Bcl-X (2604 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCL1 Tchem Induced myeloid leukemia cell differentiation protein Mcl-1 (3820 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BCL2A1 Tchem Bcl-2-related protein A1 (291 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BCL2 Tclin Apoptosis regulator Bcl-2 (3787 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

MEF (1005 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasma (10718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Liver microsomes (8692 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 700.79Molecular Weight (Monoisotopic): 700.2785AlogP: 7.58#Rotatable Bonds: 9
Polar Surface Area: 179.58Molecular Species: NEUTRALHBA: 8HBD: 8
#RO5 Violations: 3HBA (Lipinski): 10HBD (Lipinski): 8#RO5 Violations (Lipinski): 3
CX Acidic pKa: 7.72CX Basic pKa: CX LogP: 9.01CX LogD: 8.83
Aromatic Rings: 6Heavy Atoms: 52QED Weighted: 0.07Np Likeness Score: 0.13

References

1. Wei J, Stebbins JL, Kitada S, Dash R, Placzek W, Rega MF, Wu B, Cellitti J, Zhai D, Yang L, Dahl R, Fisher PB, Reed JC, Pellecchia M..  (2010)  BI-97C1, an optically pure Apogossypol derivative as pan-active inhibitor of antiapoptotic B-cell lymphoma/leukemia-2 (Bcl-2) family proteins.,  53  (10): [PMID:20443627] [10.1021/jm1001265]
2. Wei J, Stebbins JL, Kitada S, Dash R, Placzek W, Rega MF, Wu B, Cellitti J, Zhai D, Yang L, Dahl R, Fisher PB, Reed JC, Pellecchia M..  (2010)  BI-97C1, an optically pure Apogossypol derivative as pan-active inhibitor of antiapoptotic B-cell lymphoma/leukemia-2 (Bcl-2) family proteins.,  53  (10): [PMID:20443627] [10.1021/jm1001265]

Source