The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
desacetylbufotalin-3-O-sulfite ID: ALA1094625
PubChem CID: 46210591
Max Phase: Preclinical
Molecular Formula: C24H34O8S
Molecular Weight: 482.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12CC[C@H](OS(=O)(=O)O)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](c3ccc(=O)oc3)[C@@H](O)C[C@]12O
Standard InChI: InChI=1S/C24H34O8S/c1-22-9-7-16(32-33(28,29)30)11-15(22)4-5-18-17(22)8-10-23(2)21(19(25)12-24(18,23)27)14-3-6-20(26)31-13-14/h3,6,13,15-19,21,25,27H,4-5,7-12H2,1-2H3,(H,28,29,30)/t15-,16+,17+,18-,19+,21+,22+,23-,24+/m1/s1
Standard InChI Key: AKBDSCBYBRPAMM-QDLCSJEJSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
9.8313 -7.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8313 -8.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5459 -9.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5459 -7.5741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2603 -7.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2614 -8.8170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9750 -9.2295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6879 -8.8152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9729 -7.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6825 -7.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6903 -6.3405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9737 -6.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4041 -6.7598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4006 -7.5820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1815 -7.8382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6694 -7.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1873 -6.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5952 -5.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4233 -5.7880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8278 -5.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4127 -4.3558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5844 -4.3621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1714 -5.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8197 -3.6363 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3981 -5.9320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3939 -8.4055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2530 -7.1626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2571 -9.6443 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.1149 -9.2337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6747 -7.1666 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.9680 -8.3972 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.4026 -8.8214 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.6893 -9.2322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8087 -8.1062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9856 -8.1062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4925 -7.1833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16 17 1 0
17 13 1 0
18 19 1 0
7 8 1 0
8 10 1 0
9 10 1 0
3 6 1 0
5 4 1 0
5 6 1 0
18 23 2 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
17 18 1 1
21 24 2 0
9 12 1 0
13 25 1 1
10 14 1 0
14 26 1 1
13 11 1 0
5 27 1 1
11 12 1 0
6 28 1 1
13 14 1 0
2 29 1 1
1 2 1 0
10 30 1 1
1 4 1 0
9 31 1 6
2 3 1 0
29 32 1 0
5 9 1 0
32 33 1 0
6 7 1 0
32 34 2 0
14 15 1 0
32 35 2 0
15 16 1 0
16 36 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.60Molecular Weight (Monoisotopic): 482.1974AlogP: 3.04#Rotatable Bonds: 3Polar Surface Area: 134.27Molecular Species: ACIDHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: -1.45CX Basic pKa: ┄CX LogP: 0.53CX LogD: -0.43Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: 2.74
References 1. Gao H, Zehl M, Kaehlig H, Schneider P, Stuppner H, Moreno Y Banuls L, Kiss R, Kopp B.. (2010) Rapid structural identification of cytotoxic bufadienolide sulfates in toad venom from Bufo melanosticus by LC-DAD-MS(n) and LC-SPE-NMR., 73 (4): [PMID:20361780 ] [10.1021/np900746k ]