The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Artorigidin A ID: ALA1094756
PubChem CID: 46834285
Max Phase: Preclinical
Molecular Formula: C30H32O7
Molecular Weight: 504.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)[C@H]1Cc2c(oc3c(CC=C(C)C)c(O)c(CC=C(C)C)c(O)c3c2=O)-c2c(O)cc(O)c(O)c21
Standard InChI: InChI=1S/C30H32O7/c1-13(2)7-9-16-25(33)17(10-8-14(3)4)29-24(26(16)34)27(35)19-11-18(15(5)6)22-23(30(19)37-29)20(31)12-21(32)28(22)36/h7-8,12,18,31-34,36H,5,9-11H2,1-4,6H3/t18-/m1/s1
Standard InChI Key: LAAYVNVIRVOBNR-GOSISDBHSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
-2.7554 0.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7566 -0.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0418 -0.9609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0436 0.6920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3283 0.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3275 -0.5440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6123 -0.9549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6179 0.6970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0980 0.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0997 -0.5418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8167 -0.9537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5366 -0.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6105 -1.7799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0399 -1.7859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4700 0.6915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0461 1.5169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7617 1.9272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7642 2.7521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4799 3.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0510 3.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4714 -0.9600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1854 -0.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9002 -0.9589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6142 -0.5459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9008 -1.7839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2514 -0.9507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2520 -1.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9655 -0.5377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8132 0.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5342 0.2931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2531 0.7093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2522 1.5416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5264 1.9559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8105 1.5373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0943 1.9467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9653 1.9562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9680 0.2977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16 17 1 0
9 8 1 0
17 18 2 0
8 5 1 0
18 19 1 0
9 10 2 0
18 20 1 0
5 4 2 0
2 21 1 0
4 1 1 0
21 22 1 0
22 23 2 0
2 3 1 0
23 24 1 0
9 29 1 0
23 25 1 0
10 11 1 0
12 26 1 1
11 12 1 0
26 27 1 0
12 30 1 0
26 28 2 0
5 6 1 0
7 13 2 0
29 30 2 0
3 6 2 0
30 31 1 0
3 14 1 0
31 32 2 0
6 7 1 0
32 33 1 0
1 15 1 0
33 34 2 0
34 29 1 0
7 10 1 0
34 35 1 0
4 16 1 0
32 36 1 0
1 2 2 0
31 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.58Molecular Weight (Monoisotopic): 504.2148AlogP: 6.22#Rotatable Bonds: 5Polar Surface Area: 131.36Molecular Species: ACIDHBA: 7HBD: 5#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.20CX Basic pKa: ┄CX LogP: 6.67CX LogD: 5.35Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.16Np Likeness Score: 2.28
References 1. Ren Y, Kardono LB, Riswan S, Chai H, Farnsworth NR, Soejarto DD, Carcache de Blanco EJ, Kinghorn AD.. (2010) Cytotoxic and NF-kappaB inhibitory constituents of Artocarpus rigida., 73 (5): [PMID:20384315 ] [10.1021/np1002065 ] 2. Toume K, Habu T, Arai MA, Koyano T, Kowithayakorn T, Ishibashi M.. (2015) Prenylated flavonoids and resveratrol derivatives isolated from Artocarpus communis with the ability to overcome TRAIL resistance., 78 (1): [PMID:25537111 ] [10.1021/np500734t ]