Artorigidin A

ID: ALA1094756

PubChem CID: 46834285

Max Phase: Preclinical

Molecular Formula: C30H32O7

Molecular Weight: 504.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C(C)[C@H]1Cc2c(oc3c(CC=C(C)C)c(O)c(CC=C(C)C)c(O)c3c2=O)-c2c(O)cc(O)c(O)c21

Standard InChI:  InChI=1S/C30H32O7/c1-13(2)7-9-16-25(33)17(10-8-14(3)4)29-24(26(16)34)27(35)19-11-18(15(5)6)22-23(30(19)37-29)20(31)12-21(32)28(22)36/h7-8,12,18,31-34,36H,5,9-11H2,1-4,6H3/t18-/m1/s1

Standard InChI Key:  LAAYVNVIRVOBNR-GOSISDBHSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   -2.7554    0.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7566   -0.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0418   -0.9609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0436    0.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3283    0.2828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3275   -0.5440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6123   -0.9549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6179    0.6970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0980    0.2898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0997   -0.5418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8167   -0.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5366   -0.5388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6105   -1.7799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0399   -1.7859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4700    0.6915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0461    1.5169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7617    1.9272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7642    2.7521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4799    3.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0510    3.1668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4714   -0.9600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1854   -0.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9002   -0.9589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6142   -0.5459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9008   -1.7839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2514   -0.9507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2520   -1.7757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9655   -0.5377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8132    0.7094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5342    0.2931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2531    0.7093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2522    1.5416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5264    1.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8105    1.5373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0943    1.9467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9653    1.9562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9680    0.2977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  1  0
  9  8  1  0
 17 18  2  0
  8  5  1  0
 18 19  1  0
  9 10  2  0
 18 20  1  0
  5  4  2  0
  2 21  1  0
  4  1  1  0
 21 22  1  0
 22 23  2  0
  2  3  1  0
 23 24  1  0
  9 29  1  0
 23 25  1  0
 10 11  1  0
 12 26  1  1
 11 12  1  0
 26 27  1  0
 12 30  1  0
 26 28  2  0
  5  6  1  0
  7 13  2  0
 29 30  2  0
  3  6  2  0
 30 31  1  0
  3 14  1  0
 31 32  2  0
  6  7  1  0
 32 33  1  0
  1 15  1  0
 33 34  2  0
 34 29  1  0
  7 10  1  0
 34 35  1  0
  4 16  1  0
 32 36  1  0
  1  2  2  0
 31 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA1094756

    ARTORIGIDIN A

Associated Targets(Human)

NFKB1 Tclin Nuclear factor NF-kappa-B p105 subunit (1459 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RELA Tchem Nuclear factor NF-kappa-B p65 subunit (627 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HT-29 (80576 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AGS (1999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 504.58Molecular Weight (Monoisotopic): 504.2148AlogP: 6.22#Rotatable Bonds: 5
Polar Surface Area: 131.36Molecular Species: ACIDHBA: 7HBD: 5
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.20CX Basic pKa: CX LogP: 6.67CX LogD: 5.35
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.16Np Likeness Score: 2.28

References

1. Ren Y, Kardono LB, Riswan S, Chai H, Farnsworth NR, Soejarto DD, Carcache de Blanco EJ, Kinghorn AD..  (2010)  Cytotoxic and NF-kappaB inhibitory constituents of Artocarpus rigida.,  73  (5): [PMID:20384315] [10.1021/np1002065]
2. Toume K, Habu T, Arai MA, Koyano T, Kowithayakorn T, Ishibashi M..  (2015)  Prenylated flavonoids and resveratrol derivatives isolated from Artocarpus communis with the ability to overcome TRAIL resistance.,  78  (1): [PMID:25537111] [10.1021/np500734t]

Source