The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
moluccensins H ID: ALA1094916
PubChem CID: 46211773
Max Phase: Preclinical
Molecular Formula: C36H44O11
Molecular Weight: 652.74
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: Moluccensins H | moluccensins H|CHEMBL1094916
Canonical SMILES: CC[C@H](C)C(=O)O[C@@]12C[C@]3(C)[C@H](OC(=O)C(C)C)[C@]1(O)C(=O)C1=C(CC[C@]4(C)C1=CC(=O)O[C@H]4c1ccoc1)[C@]2(C)[C@H]3CC(=O)OC
Standard InChI: InChI=1S/C36H44O11/c1-9-19(4)30(41)47-35-17-33(6)23(15-24(37)43-8)34(35,7)21-10-12-32(5)22(14-25(38)45-28(32)20-11-13-44-16-20)26(21)27(39)36(35,42)31(33)46-29(40)18(2)3/h11,13-14,16,18-19,23,28,31,42H,9-10,12,15,17H2,1-8H3/t19-,23-,28-,31-,32+,33-,34+,35+,36+/m0/s1
Standard InChI Key: RTUULIKPFWFGBC-RKVWQHKYSA-N
Molfile:
RDKit 2D
47 52 0 0 0 0 0 0 0 0999 V2000
-2.0671 -2.1698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0736 -2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3642 -3.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4497 -0.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2630 -0.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9768 -0.4418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9750 -1.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6912 -1.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4123 -1.2742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4142 -0.4451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6907 -0.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1230 -1.6898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6926 0.7965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3573 1.2834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1008 2.0626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2799 2.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0236 1.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2658 -1.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4529 -1.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1640 -1.6764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1663 -2.5044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4519 -2.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2647 -2.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9766 -2.9197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2486 -2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8677 -3.2077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3760 -4.2279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4584 -2.0847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5847 -0.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7741 -1.7493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7635 -0.9243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4704 -0.5038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0458 -0.5243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4598 0.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9691 0.3840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0941 -4.6313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1059 -5.4519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8007 -4.2056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8284 -5.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4038 -5.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2944 -0.0111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5820 0.4014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0069 0.4014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7236 -0.0111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0069 1.2222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7236 1.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2445 -3.7107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
4 19 1 0
18 7 1 0
6 5 1 0
5 4 1 0
6 7 1 0
6 11 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
9 12 2 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 13 1 0
11 13 1 6
18 19 2 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
3 22 1 0
1 20 1 0
2 25 1 0
25 21 1 0
2 26 1 1
3 27 1 1
21 28 1 6
20 29 1 6
1 30 1 6
30 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
6 35 1 6
27 36 1 0
36 37 1 0
36 38 2 0
37 39 1 0
37 40 1 0
28 41 1 0
41 42 2 0
41 43 1 0
43 44 1 1
43 45 1 0
45 46 1 0
22 47 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 652.74Molecular Weight (Monoisotopic): 652.2884AlogP: 4.72#Rotatable Bonds: 8Polar Surface Area: 155.64Molecular Species: NEUTRALHBA: 11HBD: 1#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.03CX Basic pKa: ┄CX LogP: 4.82CX LogD: 4.82Aromatic Rings: 1Heavy Atoms: 47QED Weighted: 0.31Np Likeness Score: 2.66
References 1. Wu J, Yang SX, Li MY, Feng G, Pan JY, Xiao Q, Sinkkonen J, Satyanandamurty T.. (2010) Limonoids and tirucallane derivatives from the seeds of a krishna mangrove, Xylocarpus moluccensis., 73 (4): [PMID:20146503 ] [10.1021/np900823c ]