2-[2-(mercapto-phenyl)]-3a,4,9,9a-tetrahydro-4,9-benzeno-benz[f]-isoindole-1,3-dione

ID: ALA1094924

PubChem CID: 3114430

Max Phase: Preclinical

Molecular Formula: C24H17NO2S

Molecular Weight: 383.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1C2C3c4ccccc4C(c4ccccc43)C2C(=O)N1c1ccccc1S

Standard InChI:  InChI=1S/C24H17NO2S/c26-23-21-19-13-7-1-2-8-14(13)20(16-10-4-3-9-15(16)19)22(21)24(27)25(23)17-11-5-6-12-18(17)28/h1-12,19-22,28H

Standard InChI Key:  SLKVZVWZWZGCHA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 33  0  0  0  0  0  0  0  0999 V2000
   -2.0926   -0.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1360    1.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2565   -0.1903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7472   -0.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0564   -1.6052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8743   -1.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3823   -1.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0705   -0.3027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8233    1.4675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2860    0.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1089    0.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4701    1.5848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0023    2.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1811    2.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3188   -0.0562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3392    0.7686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5610    1.0429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0599    0.3882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5282   -0.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3283    1.8240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2571   -1.0604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7858   -1.0032    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.1794   -0.2895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7556    0.4064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1484    1.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9643    1.1362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3856    0.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9903   -0.2769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  2  0
 13 14  2  0
 14  9  1  0
  1 10  1  0
  3  2  1  0
 15 16  1  0
  9  2  1  0
  6  7  1  0
  2 16  1  0
  7  8  2  0
  8  3  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
 17 20  2  0
  3  4  2  0
 19 21  2  0
  9 10  2  0
  1  4  1  0
 22 23  1  0
 10 11  1  0
 23 24  2  0
  4  5  1  0
 24 25  1  0
 11 12  2  0
 25 26  2  0
 15  1  1  0
 26 27  1  0
 12 13  1  0
 27 28  2  0
 28 23  1  0
 24 18  1  0
M  END

Associated Targets(non-human)

Bacillus thuringiensis (718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Escherichia coli (133304 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 383.47Molecular Weight (Monoisotopic): 383.0980AlogP: 4.37#Rotatable Bonds: 1
Polar Surface Area: 37.38Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: 6.04CX Basic pKa: CX LogP: 4.12CX LogD: 3.01
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.50Np Likeness Score: -0.52

References

1. Khalil AM, Berghot MA, Gouda MA..  (2010)  Synthesis and study of some new 1,3-isoindoledione derivatives as potential antibacterial agents.,  45  (4): [PMID:20117862] [10.1016/j.ejmech.2009.12.064]

Source