2-((S)-2,6-Dioxo-3-((S)-pyrrolidine-2-carboxamido)piperidin-1-yl)acetic acid hydrochloride

ID: ALA1094936

PubChem CID: 44482214

Max Phase: Preclinical

Molecular Formula: C13H21ClN4O5

Molecular Weight: 312.33

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cl.N[C@H](C(=O)N[C@H]1CCC(=O)N(CC(=O)O)C1=O)C1CCCN1

Standard InChI:  InChI=1S/C13H20N4O5.ClH/c14-11(7-2-1-5-15-7)12(21)16-8-3-4-9(18)17(13(8)22)6-10(19)20;/h7-8,11,15H,1-6,14H2,(H,16,21)(H,19,20);1H/t7?,8-,11-;/m0./s1

Standard InChI Key:  NQVADOJNTDAZOB-KLUZNBEGSA-N

Molfile:  

     RDKit          2D

 23 23  0  0  0  0  0  0  0  0999 V2000
   18.1765  -15.2805    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.7790  -16.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4946  -15.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0634  -15.6498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2102  -16.0605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4946  -14.8241    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9257  -15.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6363  -16.0620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3456  -15.6548    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3498  -14.8288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6386  -14.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9189  -14.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6334  -16.8877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0669  -14.4167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0596  -16.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7767  -15.6601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4908  -16.0736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7798  -14.8346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7790  -16.8820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1171  -17.3685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3710  -18.1498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1925  -18.1498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4462  -17.3685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8 13  2  0
  7  5  1  1
 10 14  2  0
  7  8  1  0
  9 15  1  0
  2  4  1  0
 15 16  1  0
 16 17  1  0
  3  5  1  0
 16 18  2  0
  2  3  1  0
  2 19  1  6
 19 20  1  0
  3  6  2  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  1  0
 10 11  1  0
 11 12  1  0
M  END

Associated Targets(Human)

ANPEP Tchem Aminopeptidase N (863 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 312.33Molecular Weight (Monoisotopic): 312.1434AlogP: -2.22#Rotatable Bonds: 5
Polar Surface Area: 141.83Molecular Species: ZWITTERIONHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 3.16CX Basic pKa: 10.16CX LogP: -5.09CX LogD: -5.09
Aromatic Rings: Heavy Atoms: 22QED Weighted: 0.42Np Likeness Score: 0.12

References

1. Li Q, Fang H, Wang X, Xu W..  (2010)  Novel cyclic-imide peptidomimetics as aminopeptidase N inhibitors. Structure-based design, chemistry and activity evaluation. II.,  45  (4): [PMID:20129718] [10.1016/j.ejmech.2009.12.071]
2. Chen, H H, Noble, F F, Roques, B P BP and Fournié-Zaluski, M C MC.  2001-10-11  Long lasting antinociceptive properties of enkephalin degrading enzyme (NEP and APN) inhibitor prodrugs.  [PMID:11585456]
3. Vassiliou, Stamatia S and 7 more authors.  2014-10-09  Structure-guided, single-point modifications in the phosphinic dipeptide structure yield highly potent and selective inhibitors of neutral aminopeptidases.  [PMID:25192493]
4. Węglarz-Tomczak, Ewelina and 5 more authors.  2016-07-19  A structural insight into the P1S1 binding mode of diaminoethylphosphonic and phosphinic acids, selective inhibitors of alanine aminopeptidases.  [PMID:27100031]
5. Singh, Rohit R, Williams, Jessica J and Vince, Robert R.  2017-10-20  Puromycin based inhibitors of aminopeptidases for the potential treatment of hematologic malignancies.  [PMID:28803047]
6. Pascual, Isel and 10 more authors.  2017-11  Discovery of novel non-competitive inhibitors of mammalian neutral M1 aminopeptidase (APN).  [PMID:28964831]

Source