1-(4-((1H-benzo[d]imidazol-2-yl)methyl)-1,4-diazepan-1-yl)-2-(4-methoxyphenylamino)ethanone

ID: ALA1095090

PubChem CID: 46887805

Max Phase: Preclinical

Molecular Formula: C22H27N5O2

Molecular Weight: 393.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(NCC(=O)N2CCCN(Cc3nc4ccccc4[nH]3)CC2)cc1

Standard InChI:  InChI=1S/C22H27N5O2/c1-29-18-9-7-17(8-10-18)23-15-22(28)27-12-4-11-26(13-14-27)16-21-24-19-5-2-3-6-20(19)25-21/h2-3,5-10,23H,4,11-16H2,1H3,(H,24,25)

Standard InChI Key:  YWLSBQPNEWXOBH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   -3.1984    1.1302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1856    0.3045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4633   -0.0963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4970    1.5528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7775    1.1603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7561    0.3303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4877    0.7660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9899    1.4322    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3381    0.7807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7977    0.0971    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6218    0.2234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2052   -0.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3825   -0.6162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1546   -1.1745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6850   -1.3863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4703   -1.6316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8677   -1.5896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5840   -1.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0095   -1.1779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7250   -1.5902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4290   -1.1828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4290   -0.3643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7182    0.0495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0069   -0.3622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2992   -1.5872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8677   -2.4123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1508    0.0534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8625   -0.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9643    0.0960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
 12 14  1  0
 13 15  1  0
 14 16  1  0
 15 16  1  0
 14 17  1  0
  1  2  2  0
 17 18  1  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 19 25  1  0
 25 18  1  0
  7  8  2  0
 17 26  2  0
  8  5  1  0
 22 27  1  0
  7  9  1  0
 27 28  1  0
  9 10  1  0
  6 29  1  0
 29  7  1  0
M  END

Associated Targets(Human)

CACNA1G Tclin Voltage-gated T-type calcium channel alpha-1G subunit (1361 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 393.49Molecular Weight (Monoisotopic): 393.2165AlogP: 2.72#Rotatable Bonds: 6
Polar Surface Area: 73.49Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.48CX Basic pKa: 6.16CX LogP: 1.40CX LogD: 1.37
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -1.93

References

1. Gu SJ, Lee JK, Pae AN, Chung HJ, Rhim H, Han SY, Min SJ, Cho YS..  (2010)  Synthesis and biological evaluation of 1,4-diazepane derivatives as T-type calcium channel blockers.,  20  (9): [PMID:20382529] [10.1016/j.bmcl.2010.03.084]

Source