(S)-N-((S)-1-(2-(Hydroxyamino)-2-oxoethyl)-2,6-dioxopiperidin-3-yl)pyrrolidine-2-carboxamide hydrochloride

ID: ALA1095253

PubChem CID: 44482218

Max Phase: Preclinical

Molecular Formula: C13H22ClN5O5

Molecular Weight: 327.34

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cl.N[C@H](C(=O)N[C@H]1CCC(=O)N(CC(=O)NO)C1=O)C1CCCN1

Standard InChI:  InChI=1S/C13H21N5O5.ClH/c14-11(7-2-1-5-15-7)12(21)16-8-3-4-10(20)18(13(8)22)6-9(19)17-23;/h7-8,11,15,23H,1-6,14H2,(H,16,21)(H,17,19);1H/t7?,8-,11-;/m0./s1

Standard InChI Key:  TVWOSCGPORQZAP-KLUZNBEGSA-N

Molfile:  

     RDKit          2D

 24 24  0  0  0  0  0  0  0  0999 V2000
   18.0645  -16.7202    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.6670  -17.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3826  -17.0894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9514  -17.0894    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0981  -17.5002    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3826  -16.2638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8137  -17.0894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5242  -17.5018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2336  -17.0945    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2378  -16.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5265  -15.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8069  -16.2644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5214  -18.3273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9549  -15.8563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9476  -17.5079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6647  -17.0999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3787  -17.5133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6678  -16.2742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6670  -18.3217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0051  -18.8082    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2590  -19.5894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0805  -19.5894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3342  -18.8082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0907  -17.1035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  8 13  2  0
  7  5  1  1
 10 14  2  0
  7  8  1  0
  9 15  1  0
  2  4  1  0
 15 16  1  0
 16 17  1  0
  3  5  1  0
 16 18  2  0
  2  3  1  0
  2 19  1  6
 19 20  1  0
  3  6  2  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  1  0
 10 11  1  0
 17 24  1  0
 11 12  1  0
M  END

Associated Targets(Human)

ANPEP Tchem Aminopeptidase N (863 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 327.34Molecular Weight (Monoisotopic): 327.1543AlogP: -2.80#Rotatable Bonds: 5
Polar Surface Area: 153.86Molecular Species: BASEHBA: 7HBD: 5
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.73CX Basic pKa: 10.16CX LogP: -4.65CX LogD: -5.75
Aromatic Rings: Heavy Atoms: 23QED Weighted: 0.21Np Likeness Score: 0.00

References

1. Li Q, Fang H, Wang X, Xu W..  (2010)  Novel cyclic-imide peptidomimetics as aminopeptidase N inhibitors. Structure-based design, chemistry and activity evaluation. II.,  45  (4): [PMID:20129718] [10.1016/j.ejmech.2009.12.071]
2. Chen, H H, Noble, F F, Roques, B P BP and Fournié-Zaluski, M C MC.  2001-10-11  Long lasting antinociceptive properties of enkephalin degrading enzyme (NEP and APN) inhibitor prodrugs.  [PMID:11585456]
3. Vassiliou, Stamatia S and 7 more authors.  2014-10-09  Structure-guided, single-point modifications in the phosphinic dipeptide structure yield highly potent and selective inhibitors of neutral aminopeptidases.  [PMID:25192493]
4. Węglarz-Tomczak, Ewelina and 5 more authors.  2016-07-19  A structural insight into the P1S1 binding mode of diaminoethylphosphonic and phosphinic acids, selective inhibitors of alanine aminopeptidases.  [PMID:27100031]
5. Singh, Rohit R, Williams, Jessica J and Vince, Robert R.  2017-10-20  Puromycin based inhibitors of aminopeptidases for the potential treatment of hematologic malignancies.  [PMID:28803047]
6. Pascual, Isel and 10 more authors.  2017-11  Discovery of novel non-competitive inhibitors of mammalian neutral M1 aminopeptidase (APN).  [PMID:28964831]

Source