2-[5-({(2R)-2-Amino-3-[3-(trifluoromethyl)phenyl]propyl}oxy)pyridin-3-yl]-8,9-dimethoxybenzo[c]-2,7-naphthyridin-4-amine

ID: ALA1095285

PubChem CID: 25060675

Max Phase: Preclinical

Molecular Formula: C29H26F3N5O3

Molecular Weight: 549.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2ncc3c(N)nc(-c4cncc(OC[C@H](N)Cc5cccc(C(F)(F)F)c5)c4)cc3c2cc1OC

Standard InChI:  InChI=1S/C29H26F3N5O3/c1-38-26-10-22-21-9-24(37-28(34)23(21)14-36-25(22)11-27(26)39-2)17-8-20(13-35-12-17)40-15-19(33)7-16-4-3-5-18(6-16)29(30,31)32/h3-6,8-14,19H,7,15,33H2,1-2H3,(H2,34,37)/t19-/m1/s1

Standard InChI Key:  WEKPBIWDHVJAHJ-LJQANCHMSA-N

Molfile:  

     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
    8.2341  -14.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2328  -15.1036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9458  -15.5165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9438  -13.8633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6618  -14.2721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6610  -15.1056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3784  -15.5209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1014  -15.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3802  -13.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1033  -14.2768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8273  -13.8646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8344  -13.0274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1113  -12.6044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3811  -13.0184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5387  -14.2821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1170  -11.7794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8387  -11.3710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8446  -10.5468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1326  -10.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4130  -10.5407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4105  -11.3635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5621  -10.1397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2735  -10.5573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9909  -10.1501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7023  -10.5677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9970   -9.3252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5193  -13.8642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8052  -14.2772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5179  -15.5151    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8040  -15.1015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4197  -10.1606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1331  -10.5852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8501  -10.1787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8566   -9.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1401   -8.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4261   -9.3442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5612  -10.5967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5548  -11.4216    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.2789  -10.1898    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.2679  -11.0084    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 18 19  2  0
  9 10  2  0
 19 20  1  0
  5  4  2  0
 20 21  2  0
 21 16  1  0
  4  1  1  0
 18 22  1  0
  5  6  1  0
 22 23  1  0
 23 24  1  0
  2  3  1  0
 24 25  1  6
  3  6  2  0
 24 26  1  0
  9 14  1  0
  1 27  1  0
 10 11  1  0
 27 28  1  0
 11 12  2  0
  2 29  1  0
 12 13  1  0
 29 30  1  0
 13 14  2  0
 25 31  1  0
  1  2  2  0
 31 32  2  0
 11 15  1  0
 32 33  1  0
  5  9  1  0
 33 34  2  0
 13 16  1  0
 34 35  1  0
  6  7  1  0
 35 36  2  0
 36 31  1  0
 16 17  2  0
 33 37  1  0
  7  8  2  0
 37 38  1  0
 17 18  1  0
 37 39  1  0
  8 10  1  0
 37 40  1  0
M  END

Associated Targets(Human)

PDPK1 Tchem 3-phosphoinositide dependent protein kinase-1 (3758 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AKT1 Tchem Serine/threonine-protein kinase AKT (9192 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RPS6KB1 Tchem Ribosomal protein S6 kinase 1 (4456 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 549.55Molecular Weight (Monoisotopic): 549.1988AlogP: 5.41#Rotatable Bonds: 8
Polar Surface Area: 118.40Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.26CX LogP: 4.16CX LogD: 2.30
Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -0.73

References

1. Nittoli T, Dushin RG, Ingalls C, Cheung K, Floyd MB, Fraser H, Olland A, Hu Y, Grosu G, Han X, Arndt K, Guo B, Wissner A..  (2010)  The identification of 8,9-dimethoxy-5-(2-aminoalkoxy-pyridin-3-yl)-benzo[c][2,7]naphthyridin-4-ylamines as potent inhibitors of 3-phosphoinositide-dependent kinase-1 (PDK-1).,  45  (4): [PMID:20074837] [10.1016/j.ejmech.2009.12.036]

Source