The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Benzyl-3-(carbonyl-valine ethyl ester)-9-phenylpropyl-bcarbolinium bromate ID: ALA1095570
PubChem CID: 46193148
Max Phase: Preclinical
Molecular Formula: C35H38BrN3O3
Molecular Weight: 548.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)[C@@H](NC(=O)c1cc2c3ccccc3n(CCCc3ccccc3)c2c[n+]1Cc1ccccc1)C(C)C.[Br-]
Standard InChI: InChI=1S/C35H37N3O3.BrH/c1-4-41-35(40)33(25(2)3)36-34(39)31-22-29-28-19-11-12-20-30(28)38(21-13-18-26-14-7-5-8-15-26)32(29)24-37(31)23-27-16-9-6-10-17-27;/h5-12,14-17,19-20,22,24-25,33H,4,13,18,21,23H2,1-3H3;1H/t33-;/m0./s1
Standard InChI Key: ONJRCSLWLPJEPF-WAQYZQTGSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
1.5834 -6.0875 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
0.2052 -4.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2260 -3.2392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9071 -1.0532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4021 -1.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0753 -2.4741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0896 -1.1472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2399 -1.9026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2535 -2.5656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0194 -2.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0132 -2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7262 -3.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4460 -3.0032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4482 -2.1717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7345 -1.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1636 -1.7609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8771 -2.1751 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1656 -0.9359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5926 -1.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3061 -2.1784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5945 -0.9393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0215 -1.7676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3041 -3.0034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7350 -2.1818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4504 -1.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3099 -0.5284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5194 -4.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5401 -5.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2648 -5.6775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9650 -5.2438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6891 -5.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7103 -6.4632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0014 -6.8935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2802 -6.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8810 -0.5251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1586 -3.4189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1548 -4.2439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4378 -4.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4337 -5.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1468 -5.8904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8655 -5.4767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8661 -4.6538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19 20 1 0
10 8 1 0
19 21 1 1
2 3 1 0
20 22 1 0
5 6 1 0
20 23 2 0
10 11 2 0
22 24 1 0
6 9 2 0
24 25 1 0
11 12 1 0
21 26 1 0
2 27 1 0
12 13 2 0
27 28 1 0
8 7 2 0
28 29 1 0
13 14 1 0
29 30 2 0
7 4 1 0
30 31 1 0
14 15 2 0
31 32 2 0
15 10 1 0
32 33 1 0
8 9 1 0
33 34 2 0
34 29 1 0
14 16 1 0
21 35 1 0
13 36 1 0
36 37 1 0
16 17 1 0
37 38 2 0
4 5 2 0
38 39 1 0
16 18 2 0
39 40 2 0
9 3 1 0
40 41 1 0
17 19 1 0
41 42 2 0
42 37 1 0
3 11 1 0
M CHG 2 1 -1 13 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 548.71Molecular Weight (Monoisotopic): 548.2908AlogP: 6.08#Rotatable Bonds: 11Polar Surface Area: 64.21Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.33CX Basic pKa: ┄CX LogP: 2.77CX LogD: 2.77Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.16Np Likeness Score: -0.52
References 1. Ma C, Cao R, Shi B, Li S, Chen Z, Yi W, Peng W, Ren Z, Song H.. (2010) Synthesis and cytotoxic evaluation of N2-benzylated quaternary beta-carboline amino acid ester conjugates., 45 (4): [PMID:20122764 ] [10.1016/j.ejmech.2009.12.060 ]