2-Benzyl-3-(carbonyl-methionine ethyl ester)-9-phenylpropyl-b-carbolinium bromate

ID: ALA1095571

PubChem CID: 46193266

Max Phase: Preclinical

Molecular Formula: C35H38BrN3O3S

Molecular Weight: 580.77

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)[C@H](CCSC)NC(=O)c1cc2c3ccccc3n(CCCc3ccccc3)c2c[n+]1Cc1ccccc1.[Br-]

Standard InChI:  InChI=1S/C35H37N3O3S.BrH/c1-3-41-35(40)30(20-22-42-2)36-34(39)32-23-29-28-18-10-11-19-31(28)38(21-12-17-26-13-6-4-7-14-26)33(29)25-37(32)24-27-15-8-5-9-16-27;/h4-11,13-16,18-19,23,25,30H,3,12,17,20-22,24H2,1-2H3;1H/t30-;/m0./s1

Standard InChI Key:  BDHIPPOJZUBFLE-CZCBIWLKSA-N

Molfile:  

     RDKit          2D

 43 46  0  0  0  0  0  0  0  0999 V2000
    5.4209   -7.8334    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    4.2552   -7.6181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2760   -6.7933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1429   -4.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6479   -5.2702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9747   -6.0283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9604   -4.7013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2899   -5.4567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7965   -6.1198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0694   -5.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0632   -6.5490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7762   -6.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4960   -6.5573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4982   -5.7259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7845   -5.3119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2136   -5.3150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9271   -5.7292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2156   -4.4901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6426   -5.3184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3561   -5.7326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6445   -4.4934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0715   -5.3218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3541   -6.5576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7850   -5.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5004   -5.3251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3599   -4.0826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5306   -8.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5099   -8.8372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7852   -9.2316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0850   -8.7980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3609   -9.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3397  -10.0173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0486  -10.4476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7698  -10.0514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3619   -3.2576    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.6484   -2.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2086   -6.9730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2048   -7.7980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4878   -8.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4837   -9.0280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1968   -9.4445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9155   -9.0309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9161   -8.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 10  8  1  0
 19 21  1  1
  2  3  1  0
 20 22  1  0
  5  6  1  0
 20 23  2  0
 10 11  2  0
 22 24  1  0
  6  9  2  0
 24 25  1  0
 11 12  1  0
 21 26  1  0
  2 27  1  0
 12 13  2  0
 27 28  1  0
  8  7  2  0
 28 29  1  0
 13 14  1  0
 29 30  2  0
  7  4  1  0
 30 31  1  0
 14 15  2  0
 31 32  2  0
 15 10  1  0
 32 33  1  0
  8  9  1  0
 33 34  2  0
 34 29  1  0
 14 16  1  0
 26 35  1  0
 35 36  1  0
 16 17  1  0
 13 37  1  0
 37 38  1  0
  4  5  2  0
 38 39  2  0
 16 18  2  0
 39 40  1  0
  9  3  1  0
 40 41  2  0
 17 19  1  0
 41 42  1  0
  3 11  1  0
 42 43  2  0
 43 38  1  0
 19 20  1  0
M  CHG  2   1  -1  13   1
M  END

Associated Targets(Human)

769-P (491 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KB (17409 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
786-0 (47912 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A-375 (9258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 580.77Molecular Weight (Monoisotopic): 580.2628AlogP: 6.18#Rotatable Bonds: 13
Polar Surface Area: 64.21Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.33CX Basic pKa: CX LogP: 2.53CX LogD: 2.53
Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.13Np Likeness Score: -0.62

References

1. Ma C, Cao R, Shi B, Li S, Chen Z, Yi W, Peng W, Ren Z, Song H..  (2010)  Synthesis and cytotoxic evaluation of N2-benzylated quaternary beta-carboline amino acid ester conjugates.,  45  (4): [PMID:20122764] [10.1016/j.ejmech.2009.12.060]

Source