2-Benzyl-3-(carbonyl-phenylalanine ethyl ester)-9-phenylpropyl-b-carbolinium bromate

ID: ALA1095572

PubChem CID: 46193268

Max Phase: Preclinical

Molecular Formula: C39H38BrN3O3

Molecular Weight: 596.75

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)[C@H](Cc1ccccc1)NC(=O)c1cc2c3ccccc3n(CCCc3ccccc3)c2c[n+]1Cc1ccccc1.[Br-]

Standard InChI:  InChI=1S/C39H37N3O3.BrH/c1-2-45-39(44)34(25-30-17-8-4-9-18-30)40-38(43)36-26-33-32-22-12-13-23-35(32)42(24-14-21-29-15-6-3-7-16-29)37(33)28-41(36)27-31-19-10-5-11-20-31;/h3-13,15-20,22-23,26,28,34H,2,14,21,24-25,27H2,1H3;1H/t34-;/m0./s1

Standard InChI Key:  JHGNLOPZRPJUJB-GXUZKUJRSA-N

Molfile:  

     RDKit          2D

 46 50  0  0  0  0  0  0  0  0999 V2000
    6.1583   -5.1333    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    2.4427   -6.0305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4635   -5.2058    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3304   -3.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8354   -3.6827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1622   -4.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1479   -3.1138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4774   -3.8692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9840   -4.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2569   -4.1332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2507   -4.9615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9637   -5.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6835   -4.9698    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6857   -4.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9720   -3.7244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4011   -3.7275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1146   -4.1417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4031   -2.9025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8301   -3.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5436   -4.1450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8320   -2.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2590   -3.7342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5416   -4.9700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9725   -4.1484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6879   -3.7376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5474   -2.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7181   -6.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6974   -7.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9727   -7.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2725   -7.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4516   -7.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4728   -8.4298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2361   -8.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9573   -8.4639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2567   -2.9118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9717   -2.5017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9740   -1.6758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2555   -1.2618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5435   -1.6743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3961   -5.3856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3923   -6.2106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6753   -6.6163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6712   -7.4405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3843   -7.8571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1030   -7.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1036   -6.6205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 20 22  1  0
  4  5  2  0
 20 23  2  0
 22 24  1  0
 10 11  2  0
 24 25  1  0
  5  6  1  0
 21 26  1  0
 11 12  1  0
  2 27  1  0
  6  9  2  0
 27 28  1  0
 12 13  2  0
 28 29  1  0
  2  3  1  0
 29 30  2  0
 13 14  1  0
 30 31  1  0
  8  7  2  0
 31 32  2  0
 14 15  2  0
 32 33  1  0
 15 10  1  0
 33 34  2  0
 34 29  1  0
  7  4  1  0
 26 35  2  0
 14 16  1  0
 35 36  1  0
  8  9  1  0
 36 37  2  0
 16 17  1  0
 37 38  1  0
 38 39  2  0
 39 26  1  0
 16 18  2  0
 13 40  1  0
 40 41  1  0
 17 19  1  0
 41 42  2  0
  9  3  1  0
 42 43  1  0
 19 20  1  0
 43 44  2  0
  3 11  1  0
 44 45  1  0
 19 21  1  1
 45 46  2  0
 46 41  1  0
 10  8  1  0
M  CHG  2   1  -1  13   1
M  END

Associated Targets(Human)

769-P (491 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KB (17409 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
786-0 (47912 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A-375 (9258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 596.75Molecular Weight (Monoisotopic): 596.2908AlogP: 6.67#Rotatable Bonds: 12
Polar Surface Area: 64.21Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.33CX Basic pKa: CX LogP: 3.54CX LogD: 3.54
Aromatic Rings: 6Heavy Atoms: 45QED Weighted: 0.13Np Likeness Score: -0.39

References

1. Ma C, Cao R, Shi B, Li S, Chen Z, Yi W, Peng W, Ren Z, Song H..  (2010)  Synthesis and cytotoxic evaluation of N2-benzylated quaternary beta-carboline amino acid ester conjugates.,  45  (4): [PMID:20122764] [10.1016/j.ejmech.2009.12.060]

Source