The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-[3-(4-Cyano-benzoylamino)-2,2-dimethyl-heptanoylamino]-3-phenyl-propionic acid ethyl ester ID: ALA109601
PubChem CID: 10504812
Max Phase: Preclinical
Molecular Formula: C28H35N3O4
Molecular Weight: 477.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC(NC(=O)c1ccc(C#N)cc1)C(C)(C)C(=O)N[C@@H](Cc1ccccc1)C(=O)OCC
Standard InChI: InChI=1S/C28H35N3O4/c1-5-7-13-24(31-25(32)22-16-14-21(19-29)15-17-22)28(3,4)27(34)30-23(26(33)35-6-2)18-20-11-9-8-10-12-20/h8-12,14-17,23-24H,5-7,13,18H2,1-4H3,(H,30,34)(H,31,32)/t23-,24?/m0/s1
Standard InChI Key: ZTCBHOFUKJGZBF-UXMRNZNESA-N
Molfile:
RDKit 2D
35 36 0 0 1 0 0 0 0 0999 V2000
5.5292 -9.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8167 -9.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6792 -9.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2417 -9.7542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3917 -9.7667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1042 -9.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9542 -9.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6667 -9.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8875 -11.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1708 -11.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -9.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5250 -8.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6750 -8.5292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9500 -8.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6667 -10.5792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2500 -9.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -10.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5417 -10.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3792 -9.3375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4000 -10.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2250 -10.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2542 -11.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5375 -9.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6625 -8.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1000 -8.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0917 -9.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3750 -8.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6542 -7.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3792 -8.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3792 -7.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8042 -9.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6667 -6.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3667 -6.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0917 -8.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0875 -7.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 5 1 0
4 1 1 0
5 6 1 0
6 2 1 0
7 4 1 0
8 7 1 0
9 10 3 0
10 18 1 0
11 3 1 0
12 1 2 0
13 3 2 0
7 14 1 1
15 8 2 0
16 11 2 0
17 11 1 0
18 22 1 0
19 8 1 0
20 2 1 0
21 2 1 0
22 17 2 0
23 16 1 0
24 14 1 0
25 6 1 0
26 19 1 0
27 24 2 0
28 24 1 0
29 25 1 0
30 29 1 0
31 26 1 0
32 30 1 0
33 28 2 0
34 27 1 0
35 33 1 0
34 35 2 0
23 18 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.61Molecular Weight (Monoisotopic): 477.2628AlogP: 4.16#Rotatable Bonds: 12Polar Surface Area: 108.29Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.17CX Basic pKa: ┄CX LogP: 5.17CX LogD: 5.17Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.45Np Likeness Score: -0.60
References 1. Iijima K, Katada J, Yasuda E, Uno I, Hayashi Y.. (1999) N-[2,2-dimethyl-3-(N-(4-cyanobenzoyl)amino)nonanoyl]-L-phenylalanine ethyl ester as a stable ester-type inhibitor of chymotrypsin-like serine proteases: structural requirements for potent inhibition of alpha-chymotrypsin., 42 (2): [PMID:9925737 ] [10.1021/jm980562h ]