2-(4-((1H-benzo[d]imidazol-2-yl)methyl)-1,4-diazepan-1-yl)-N-p-tolylacetamide

ID: ALA1096204

PubChem CID: 46888331

Max Phase: Preclinical

Molecular Formula: C22H27N5O

Molecular Weight: 377.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(NC(=O)CN2CCCN(Cc3nc4ccccc4[nH]3)CC2)cc1

Standard InChI:  InChI=1S/C22H27N5O/c1-17-7-9-18(10-8-17)23-22(28)16-27-12-4-11-26(13-14-27)15-21-24-19-5-2-3-6-20(19)25-21/h2-3,5-10H,4,11-16H2,1H3,(H,23,28)(H,24,25)

Standard InChI Key:  SPAFHACVMYULCM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   -4.3046  -19.7501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2873  -20.5756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5647  -20.9735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6045  -19.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8807  -19.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8578  -20.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6029  -20.0926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0953  -19.4391    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7630  -20.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3011  -20.7681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5261  -20.6431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1084  -21.2254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7141  -21.4834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0582  -22.0410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4144  -22.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3733  -22.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7736  -22.4540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4884  -22.0414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4884  -21.2170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9174  -22.0413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6344  -22.4553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3406  -22.0476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3406  -21.2267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6269  -20.8146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9158  -21.2252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0590  -20.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0657  -20.7755    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2029  -22.4538    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  7  8  2  0
  8  5  1  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
 12 14  1  0
 13 15  1  0
 14 16  1  0
 15 16  1  0
 14 17  1  0
 17 18  1  0
 18 19  2  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
  1  2  2  0
  6 27  1  0
 27  7  1  0
 18 28  1  0
 28 20  1  0
M  END

Associated Targets(Human)

CACNA1G Tclin Voltage-gated T-type calcium channel alpha-1G subunit (1361 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 377.49Molecular Weight (Monoisotopic): 377.2216AlogP: 3.02#Rotatable Bonds: 5
Polar Surface Area: 64.26Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.48CX Basic pKa: 6.84CX LogP: 2.61CX LogD: 2.50
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.72Np Likeness Score: -2.15

References

1. Gu SJ, Lee JK, Pae AN, Chung HJ, Rhim H, Han SY, Min SJ, Cho YS..  (2010)  Synthesis and biological evaluation of 1,4-diazepane derivatives as T-type calcium channel blockers.,  20  (9): [PMID:20382529] [10.1016/j.bmcl.2010.03.084]

Source