2-[benzothiazol-2-yl]-3a,4,9,9a-tetrahydro-4,9-benzeno-benz[f]isoindole-1,3-dione

ID: ALA1096266

PubChem CID: 4194472

Max Phase: Preclinical

Molecular Formula: C26H18N2O2S

Molecular Weight: 422.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc2nc(N3C(=O)C4C5c6ccccc6C(c6ccccc65)C4C3=O)sc2c1

Standard InChI:  InChI=1S/C26H18N2O2S/c1-13-10-11-18-19(12-13)31-26(27-18)28-24(29)22-20-14-6-2-3-7-15(14)21(23(22)25(28)30)17-9-5-4-8-16(17)20/h2-12,20-23H,1H3

Standard InChI Key:  HOSQKJAKTRWDAR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 37  0  0  0  0  0  0  0  0999 V2000
   14.8818   -9.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8385   -8.4185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7178   -9.6102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2270  -10.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9180  -11.0252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0998  -11.1400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5917  -10.4843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9037   -9.7226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1511   -7.9521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6882   -8.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8653   -8.5785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5041   -7.8349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9720   -7.1492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7933   -7.2115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6556   -9.4761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6354   -8.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4137   -8.3769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9149   -9.0316    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4465   -9.7116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6464   -7.5956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7176  -10.4804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7303   -9.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2223   -9.6615    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.1911   -8.3426    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9738   -8.5753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9919   -9.3910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7035   -9.7809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4014   -9.3596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3832   -8.5439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6670   -8.1495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1158   -9.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 10  1  0
  3  2  1  0
 15 16  1  0
  9  2  1  0
  6  7  1  0
  2 16  1  0
  7  8  2  0
  8  3  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
 17 20  2  0
  3  4  2  0
 19 21  2  0
  9 10  2  0
 22 18  1  0
 23 26  1  0
  1  4  1  0
 10 11  1  0
 22 23  1  0
 25 24  1  0
 24 22  2  0
 25 26  2  0
  4  5  1  0
 11 12  2  0
 15  1  1  0
 12 13  1  0
  5  6  2  0
 13 14  2  0
 25 30  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 14  9  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA1096266

    CID 4194472

Associated Targets(non-human)

Bacillus thuringiensis (718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Escherichia coli (133304 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.51Molecular Weight (Monoisotopic): 422.1089AlogP: 5.00#Rotatable Bonds: 1
Polar Surface Area: 50.27Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.36CX LogD: 5.36
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.41Np Likeness Score: -1.14

References

1. Khalil AM, Berghot MA, Gouda MA..  (2010)  Synthesis and study of some new 1,3-isoindoledione derivatives as potential antibacterial agents.,  45  (4): [PMID:20117862] [10.1016/j.ejmech.2009.12.064]

Source