telocinobufagin-3-O-sulfite

ID: ALA1096270

PubChem CID: 46210729

Max Phase: Preclinical

Molecular Formula: C24H34O8S

Molecular Weight: 482.60

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C[C@]12CC[C@H](OS(=O)(=O)O)C[C@@]1(O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](c3ccc(=O)oc3)CC[C@]12O

Standard InChI:  InChI=1S/C24H34O8S/c1-21-9-5-16(32-33(28,29)30)13-23(21,26)11-7-19-18(21)6-10-22(2)17(8-12-24(19,22)27)15-3-4-20(25)31-14-15/h3-4,14,16-19,26-27H,5-13H2,1-2H3,(H,28,29,30)/t16-,17+,18-,19+,21+,22+,23-,24-/m0/s1

Standard InChI Key:  RNRSYDQILACYBK-ZBDZJSKLSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   -2.4027  -14.9236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4027  -15.7551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6882  -16.1624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6882  -14.5080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9737  -14.9236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9726  -15.7509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2591  -16.1634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4538  -15.7491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2612  -14.5089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4485  -14.9241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4562  -13.2743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2604  -13.6849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1701  -13.6937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1665  -14.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9475  -14.7721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4353  -14.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9533  -13.4444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3611  -12.7281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1893  -12.7219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5937  -12.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1786  -11.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3503  -11.2959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9373  -12.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5857  -10.5702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1640  -12.8659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1598  -15.3393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9810  -14.0964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9769  -16.5782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1191  -16.1676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4407  -14.1005    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2661  -15.3311    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8315  -15.7553    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5447  -16.1661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4253  -15.0400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2484  -15.0400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 18 19  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
 18 23  2  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 17 18  1  1
 21 24  2  0
  9 12  1  0
 13 25  1  1
 10 14  1  0
 14 26  1  1
 13 11  1  0
  5 27  1  1
 11 12  1  0
  6 28  1  1
 13 14  1  0
  2 29  1  1
  1  2  1  0
 10 30  1  1
  1  4  1  0
  9 31  1  6
  2  3  1  0
 29 32  1  0
  5  9  1  0
 32 33  1  0
  6  7  1  0
 32 34  2  0
 14 15  1  0
 32 35  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA1096270

   [(3S,5S,8R,9S,10R,13R,14S,17R)-5,14-dihydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate

Molecule Features

Natural Product: Yes

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 482.60

Molecular Weight (Monoisotopic): 482.1974

AlogP: 3.18

#Rotatable Bonds: 3

Polar Surface Area: 134.27

Molecular Species: ACID

HBA: 7

HBD: 3

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): 3

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: -1.52

CX Basic pKa: 0.28

CX LogP: 0.29

CX LogD: -0.28

Aromatic Rings: 1

Heavy Atoms: 33

QED Weighted: 0.56

Np Likeness Score: 2.54

References

1. Gao H, Zehl M, Kaehlig H, Schneider P, Stuppner H, Moreno Y Banuls L, Kiss R, Kopp B..  (2010)  Rapid structural identification of cytotoxic bufadienolide sulfates in toad venom from Bufo melanosticus by LC-DAD-MS(n) and LC-SPE-NMR.,  73  (4): [PMID:20361780] [10.1021/np900746k]

Source

Source(1):

• Scientific Literature