The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Adamantan-1-yl-6-cyclopropylmethyl-1-(4,4,4-trifluoro-butyl)-1H-pyrimido[5,4-e][1,2,4]triazine-5,7-dione ID: ALA1096282
PubChem CID: 46886685
Max Phase: Preclinical
Molecular Formula: C23H28F3N5O2
Molecular Weight: 463.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=c1nc2n(CCCC(F)(F)F)nc(C34CC5CC(CC(C5)C3)C4)nc-2c(=O)n1CC1CC1
Standard InChI: InChI=1S/C23H28F3N5O2/c24-23(25,26)4-1-5-31-18-17(19(32)30(21(33)28-18)12-13-2-3-13)27-20(29-31)22-9-14-6-15(10-22)8-16(7-14)11-22/h13-16H,1-12H2
Standard InChI Key: OYFUHLHTUCGAIY-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
4.9980 -15.5293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8723 -15.8671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5084 -16.1905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8958 -16.6251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5102 -17.0018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3483 -17.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2977 -15.8682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1154 -16.1370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6079 -15.5645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1096 -16.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8361 -14.8958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8349 -15.7232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5479 -14.4830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2633 -14.8922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2641 -15.7190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9794 -16.1300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6944 -15.7152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6896 -14.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9737 -14.4780 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4016 -14.4684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9811 -16.9550 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5455 -13.6580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4105 -16.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2587 -13.2434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4137 -16.9499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0085 -17.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8335 -17.6639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2562 -12.4184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9695 -12.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9670 -11.1788 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.6852 -12.4141 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.6792 -11.5833 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.5497 -16.1360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4 6 1 0
14 15 1 0
5 6 1 0
15 16 1 0
7 8 1 0
16 17 1 0
3 7 1 0
17 18 1 0
2 9 1 0
18 19 1 0
19 14 2 0
6 10 1 0
18 20 2 0
10 8 1 0
16 21 2 0
8 9 1 0
13 22 1 0
12 8 1 0
17 23 1 0
1 2 1 0
22 24 1 0
11 12 2 0
23 25 1 0
26 25 1 0
27 26 1 0
25 27 1 0
1 3 1 0
12 33 1 0
33 15 2 0
24 28 1 0
2 4 1 0
28 29 1 0
14 13 1 0
29 30 1 0
13 11 1 0
29 31 1 0
3 5 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.50Molecular Weight (Monoisotopic): 463.2195AlogP: 3.52#Rotatable Bonds: 6Polar Surface Area: 82.67Molecular Species: ┄HBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.83CX LogD: 3.83Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.65Np Likeness Score: -0.92
References 1. Zhou Y, Liu G, Chen J, Reddy PS, Yoon IS, Zhang M, Zhang B, Barber JR, Ng SC.. (2009) Pyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione derivatives: their cytoprotection effect from rotenone toxicity and preliminary DMPK properties., 19 (21): [PMID:19786349 ] [10.1016/j.bmcl.2009.09.021 ]