3-Adamantan-1-yl-6-cyclopropylmethyl-1-(4,4,4-trifluoro-butyl)-1H-pyrimido[5,4-e][1,2,4]triazine-5,7-dione

ID: ALA1096282

PubChem CID: 46886685

Max Phase: Preclinical

Molecular Formula: C23H28F3N5O2

Molecular Weight: 463.50

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1nc2n(CCCC(F)(F)F)nc(C34CC5CC(CC(C5)C3)C4)nc-2c(=O)n1CC1CC1

Standard InChI:  InChI=1S/C23H28F3N5O2/c24-23(25,26)4-1-5-31-18-17(19(32)30(21(33)28-18)12-13-2-3-13)27-20(29-31)22-9-14-6-15(10-22)8-16(7-14)11-22/h13-16H,1-12H2

Standard InChI Key:  OYFUHLHTUCGAIY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
    4.9980  -15.5293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8723  -15.8671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5084  -16.1905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8958  -16.6251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5102  -17.0018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3483  -17.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2977  -15.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1154  -16.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6079  -15.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1096  -16.9468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8361  -14.8958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8349  -15.7232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5479  -14.4830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2633  -14.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2641  -15.7190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9794  -16.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6944  -15.7152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6896  -14.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9737  -14.4780    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4016  -14.4684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9811  -16.9550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5455  -13.6580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4105  -16.1249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2587  -13.2434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4137  -16.9499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0085  -17.6671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8335  -17.6639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2562  -12.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9695  -12.0038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9670  -11.1788    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.6852  -12.4141    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.6792  -11.5833    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.5497  -16.1360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  4  6  1  0
 14 15  1  0
  5  6  1  0
 15 16  1  0
  7  8  1  0
 16 17  1  0
  3  7  1  0
 17 18  1  0
  2  9  1  0
 18 19  1  0
 19 14  2  0
  6 10  1  0
 18 20  2  0
 10  8  1  0
 16 21  2  0
  8  9  1  0
 13 22  1  0
 12  8  1  0
 17 23  1  0
  1  2  1  0
 22 24  1  0
 11 12  2  0
 23 25  1  0
 26 25  1  0
 27 26  1  0
 25 27  1  0
  1  3  1  0
 12 33  1  0
 33 15  2  0
 24 28  1  0
  2  4  1  0
 28 29  1  0
 14 13  1  0
 29 30  1  0
 13 11  1  0
 29 31  1  0
  3  5  1  0
 29 32  1  0
M  END

Associated Targets(Human)

SK-N-SH (1499 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.50Molecular Weight (Monoisotopic): 463.2195AlogP: 3.52#Rotatable Bonds: 6
Polar Surface Area: 82.67Molecular Species: HBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.83CX LogD: 3.83
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.65Np Likeness Score: -0.92

References

1. Zhou Y, Liu G, Chen J, Reddy PS, Yoon IS, Zhang M, Zhang B, Barber JR, Ng SC..  (2009)  Pyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione derivatives: their cytoprotection effect from rotenone toxicity and preliminary DMPK properties.,  19  (21): [PMID:19786349] [10.1016/j.bmcl.2009.09.021]

Source