1-((1,3,6,7-Tetramethoxyxanthone-4-yl)-sulfonyl)-3-(N,N-dimethylamino)-pyrrolidine

ID: ALA1096392

PubChem CID: 46887523

Max Phase: Preclinical

Molecular Formula: C23H28N2O8S

Molecular Weight: 492.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2oc3c(S(=O)(=O)N4CCC(N(C)C)C4)c(OC)cc(OC)c3c(=O)c2cc1OC

Standard InChI:  InChI=1S/C23H28N2O8S/c1-24(2)13-7-8-25(12-13)34(27,28)23-19(32-6)11-18(31-5)20-21(26)14-9-16(29-3)17(30-4)10-15(14)33-22(20)23/h9-11,13H,7-8,12H2,1-6H3

Standard InChI Key:  HWHMBDSBEBKCRS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   -2.8930  -13.1984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3185  -12.4891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1488  -12.5061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5457  -13.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0681  -13.1845    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9193  -11.7671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0945  -11.7517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3705  -13.2449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7973  -12.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2936  -13.9202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1211  -13.9331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5214  -14.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8664  -14.6263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3463  -14.6640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2712  -15.3501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0963  -15.3591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4993  -16.0771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0782  -16.7865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2500  -16.7735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8507  -16.0549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4808  -17.5067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3057  -17.5181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8260  -17.4812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2270  -18.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6437  -13.8924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6625  -12.4667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4875  -12.4667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1149  -14.5722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6155  -15.2289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8366  -14.9569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8547  -14.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1111  -15.3502    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0893  -16.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5922  -14.9189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  1  0
  4  8  1  0
 17 18  2  0
  3  4  2  0
 18 19  1  0
  8  9  1  0
 19 20  2  0
 20 15  1  0
 10 11  2  0
 18 21  1  0
  4 11  1  0
 21 22  1  0
  1  2  2  0
 19 23  1  0
  1  5  1  0
 23 24  1  0
 10  1  1  0
  5 25  1  0
 10 13  1  0
  5 26  2  0
 11 12  1  0
  5 27  2  0
 25 28  1  0
 12 16  1  0
 15 13  1  0
  2  6  1  0
 12 14  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 25  1  0
  2  3  1  0
 30 32  1  0
  6  7  1  0
 32 33  1  0
 15 16  2  0
 32 34  1  0
M  END

Associated Targets(Human)

SOAT1 Tchem Acyl coenzyme A:cholesterol acyltransferase 1 (857 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 492.55Molecular Weight (Monoisotopic): 492.1566AlogP: 2.31#Rotatable Bonds: 7
Polar Surface Area: 107.75Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.17CX LogP: 1.35CX LogD: 1.15
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -0.25

References

1. Hu H, Liao H, Zhang J, Wu W, Yan J, Yan Y, Zhao Q, Zou Y, Chai X, Yu S, Wu Q..  (2010)  First identification of xanthone sulfonamides as potent acyl-CoA:cholesterol acyltransferase (ACAT) inhibitors.,  20  (10): [PMID:20403694] [10.1016/j.bmcl.2010.03.101]

Source