The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-((1,3,6,7-Tetramethoxyxanthone-4-yl)-sulfonyl)-3-(N,N-dimethylamino)-pyrrolidine ID: ALA1096392
PubChem CID: 46887523
Max Phase: Preclinical
Molecular Formula: C23H28N2O8S
Molecular Weight: 492.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2oc3c(S(=O)(=O)N4CCC(N(C)C)C4)c(OC)cc(OC)c3c(=O)c2cc1OC
Standard InChI: InChI=1S/C23H28N2O8S/c1-24(2)13-7-8-25(12-13)34(27,28)23-19(32-6)11-18(31-5)20-21(26)14-9-16(29-3)17(30-4)10-15(14)33-22(20)23/h9-11,13H,7-8,12H2,1-6H3
Standard InChI Key: HWHMBDSBEBKCRS-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-2.8930 -13.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3185 -12.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1488 -12.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5457 -13.2284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0681 -13.1845 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.9193 -11.7671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0945 -11.7517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3705 -13.2449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.7973 -12.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2936 -13.9202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1211 -13.9331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5214 -14.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8664 -14.6263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3463 -14.6640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2712 -15.3501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0963 -15.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4993 -16.0771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0782 -16.7865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2500 -16.7735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8507 -16.0549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4808 -17.5067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3057 -17.5181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8260 -17.4812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2270 -18.2022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6437 -13.8924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6625 -12.4667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4875 -12.4667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1149 -14.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6155 -15.2289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8366 -14.9569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8547 -14.1321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1111 -15.3502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0893 -16.1749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5922 -14.9189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16 17 1 0
4 8 1 0
17 18 2 0
3 4 2 0
18 19 1 0
8 9 1 0
19 20 2 0
20 15 1 0
10 11 2 0
18 21 1 0
4 11 1 0
21 22 1 0
1 2 2 0
19 23 1 0
1 5 1 0
23 24 1 0
10 1 1 0
5 25 1 0
10 13 1 0
5 26 2 0
11 12 1 0
5 27 2 0
25 28 1 0
12 16 1 0
15 13 1 0
2 6 1 0
12 14 2 0
28 29 1 0
29 30 1 0
30 31 1 0
31 25 1 0
2 3 1 0
30 32 1 0
6 7 1 0
32 33 1 0
15 16 2 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.55Molecular Weight (Monoisotopic): 492.1566AlogP: 2.31#Rotatable Bonds: 7Polar Surface Area: 107.75Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.17CX LogP: 1.35CX LogD: 1.15Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -0.25
References 1. Hu H, Liao H, Zhang J, Wu W, Yan J, Yan Y, Zhao Q, Zou Y, Chai X, Yu S, Wu Q.. (2010) First identification of xanthone sulfonamides as potent acyl-CoA:cholesterol acyltransferase (ACAT) inhibitors., 20 (10): [PMID:20403694 ] [10.1016/j.bmcl.2010.03.101 ]