The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Erythribyssin L ID: ALA1096408
PubChem CID: 46887764
Max Phase: Preclinical
Molecular Formula: C25H28O5
Molecular Weight: 408.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Erythribyssin L | Erythribyssin L|CHEMBL1096408|BDBM50317437
Canonical SMILES: CC(C)=CCc1c(O)ccc2c1O[C@H]1c3cc4c(cc3OC[C@@H]21)OC(C)(C)C(O)C4
Standard InChI: InChI=1S/C25H28O5/c1-13(2)5-6-16-19(26)8-7-15-18-12-28-21-11-20-14(10-22(27)25(3,4)30-20)9-17(21)24(18)29-23(15)16/h5,7-9,11,18,22,24,26-27H,6,10,12H2,1-4H3/t18-,22?,24-/m0/s1
Standard InChI Key: HAOOQCMPFMLAJM-HRKCMRQESA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
6.0456 -9.1194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0438 -7.4709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7573 -7.8789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7561 -8.7097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1929 -7.8810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4734 -7.4622 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1917 -8.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4702 -9.1228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6382 -9.9360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8055 -9.2710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4630 -10.0243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9439 -10.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7673 -10.6146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1074 -9.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6244 -9.1886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9006 -8.2940 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.7523 -9.5281 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.2477 -11.2825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3328 -8.7076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3370 -7.8825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6283 -7.4686 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9111 -7.8753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9070 -8.7005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6200 -9.1189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1123 -8.0861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3242 -7.2883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1920 -9.1075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5388 -11.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7161 -11.4196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3113 -12.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4886 -12.1435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7292 -12.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 5 1 0
14 15 2 0
15 10 1 0
5 6 1 0
7 16 1 6
7 8 1 0
8 17 1 6
2 20 1 0
13 18 1 0
19 20 2 0
3 4 1 0
19 1 1 0
8 9 1 0
9 11 1 0
7 10 1 0
1 4 2 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 0
10 11 2 0
22 26 1 0
3 2 2 0
23 27 1 0
11 12 1 0
12 28 1 0
3 6 1 0
28 29 1 0
12 13 2 0
29 30 2 0
4 8 1 0
30 31 1 0
13 14 1 0
30 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.49Molecular Weight (Monoisotopic): 408.1937AlogP: 4.59#Rotatable Bonds: 2Polar Surface Area: 68.15Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.36CX Basic pKa: ┄CX LogP: 4.34CX LogD: 4.34Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.71Np Likeness Score: 2.98
References 1. Nguyen PH, Nguyen TN, Kang KW, Ndinteh DT, Mbafor JT, Kim YR, Oh WK.. (2010) Prenylated pterocarpans as bacterial neuraminidase inhibitors., 18 (9): [PMID:20363636 ] [10.1016/j.bmc.2010.03.005 ]