1-methyl-5-phenyl-3-stearoylpyrrolo[3,4-c]pyrazole-4,6(1H,5H)-dione

ID: ALA1096490

PubChem CID: 46888362

Max Phase: Preclinical

Molecular Formula: C30H43N3O3

Molecular Weight: 493.69

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCCCCCCCC(=O)c1nn(C)c2c1C(=O)N(c1ccccc1)C2=O

Standard InChI:  InChI=1S/C30H43N3O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-23-25(34)27-26-28(32(2)31-27)30(36)33(29(26)35)24-21-18-17-19-22-24/h17-19,21-22H,3-16,20,23H2,1-2H3

Standard InChI Key:  JUBICPYHOHDVHB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   -0.6447  -10.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6668   -9.1760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1414   -9.8549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1223   -9.4199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1303  -10.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9233  -10.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3939   -9.8085    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1983  -11.2658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6189  -11.8565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9379   -8.3999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8845  -11.2972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9639   -9.8629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9943  -11.4532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3817   -9.1577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2157   -9.1659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6256   -9.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2009  -10.6116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3648  -10.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1404   -8.3575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7050  -11.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4190  -11.4530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1330  -11.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8469  -11.4530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5609  -11.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2749  -11.4530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9889  -11.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7028  -11.4530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4168  -11.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1308  -11.4530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8448  -11.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5587  -11.4530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2727  -11.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9867  -11.4530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7007  -11.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4147  -11.4530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9009   -9.1470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  1  0
 17 18  2  0
 18 12  1  0
  1  5  1  0
 13 20  1  0
  4  2  1  0
 20 21  1  0
  2  3  1  0
 21 22  1  0
  3  1  1  0
 22 23  1  0
  4  5  2  0
 23 24  1  0
  5  6  1  0
 24 25  1  0
  6  7  2  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
  6  8  1  0
 28 29  1  0
  8  9  2  0
 29 30  1  0
  2 10  2  0
 30 31  1  0
  1 11  2  0
 31 32  1  0
  3 12  1  0
 32 33  1  0
  8 13  1  0
 33 34  1  0
 12 14  2  0
 34 35  1  0
 14 15  1  0
 15 16  2  0
 36 19  1  0
  7 36  1  0
 36  4  1  0
M  END

Associated Targets(Human)

CDC25B Tchem Dual specificity phosphatase Cdc25B (1099 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.69Molecular Weight (Monoisotopic): 493.3304AlogP: 7.66#Rotatable Bonds: 18
Polar Surface Area: 72.27Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 8.24CX LogD: 8.24
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.12Np Likeness Score: -0.54

References

1. Chen HJ, Liu Y, Wang LN, Shen Q, Li J, Nan FJ..  (2010)  Discovery and structural optimization of pyrazole derivatives as novel inhibitors of Cdc25B.,  20  (9): [PMID:20363629] [10.1016/j.bmcl.2010.03.040]

Source