17-{4-[(E)-2-(4-methylphenyl)diazen-1-yl]phenyl}-17-azapentacyclo[6.6.5.0^{2,7}.0^{9,14}.0^{15,19}]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione

ID: ALA1096611

PubChem CID: 46193740

Max Phase: Preclinical

Molecular Formula: C31H23N3O2

Molecular Weight: 469.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(/N=N/c2ccc(N3C(=O)C4C5c6ccccc6C(c6ccccc65)C4C3=O)cc2)cc1

Standard InChI:  InChI=1S/C31H23N3O2/c1-18-10-12-19(13-11-18)32-33-20-14-16-21(17-15-20)34-30(35)28-26-22-6-2-3-7-23(22)27(29(28)31(34)36)25-9-5-4-8-24(25)26/h2-17,26-29H,1H3/b33-32+

Standard InChI Key:  VKROFTSSNDRLLK-ULIFNZDWSA-N

Molfile:  

     RDKit          2D

 36 42  0  0  0  0  0  0  0  0999 V2000
   10.0630  -15.7448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0196  -14.4045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8963  -15.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4067  -16.2512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0970  -17.0172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2770  -17.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7677  -16.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0804  -15.7116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3306  -13.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8667  -14.6240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0419  -14.5649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6799  -13.8196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1488  -13.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9720  -13.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8386  -15.4645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8183  -14.6377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5984  -14.3629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1007  -15.0191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6313  -15.7006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8316  -13.5798    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9030  -16.4711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9174  -14.9987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3388  -15.6964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1549  -15.6762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5463  -14.9581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1158  -14.2587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3011  -14.2822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3630  -14.9365    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7527  -14.2184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5695  -14.1968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9923  -14.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8084  -14.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1989  -14.1553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7674  -13.4565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9528  -13.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0155  -14.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2 16  1  0
  7  8  2  0
  8  3  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
 17 20  2  0
  3  4  2  0
 19 21  2  0
  9 10  2  0
 18 22  1  0
  1  4  1  0
 22 23  2  0
 10 11  1  0
 23 24  1  0
  4  5  1  0
 24 25  2  0
 11 12  2  0
 25 26  1  0
 15  1  1  0
 26 27  2  0
 27 22  1  0
 12 13  1  0
 25 28  1  0
  5  6  2  0
 28 29  2  0
 13 14  2  0
 29 30  1  0
 14  9  1  0
 30 31  2  0
  1 10  1  0
 31 32  1  0
  3  2  1  0
 32 33  2  0
 15 16  1  0
 33 34  1  0
  9  2  1  0
 34 35  2  0
 35 30  1  0
  6  7  1  0
 33 36  1  0
M  END

Associated Targets(non-human)

Bacillus thuringiensis (718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Escherichia coli (133304 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.54Molecular Weight (Monoisotopic): 469.1790AlogP: 6.81#Rotatable Bonds: 3
Polar Surface Area: 62.10Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.50CX LogP: 6.95CX LogD: 6.95
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.24Np Likeness Score: -0.67

References

1. Khalil AM, Berghot MA, Gouda MA..  (2010)  Synthesis and study of some new 1,3-isoindoledione derivatives as potential antibacterial agents.,  45  (4): [PMID:20117862] [10.1016/j.ejmech.2009.12.064]

Source