The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(9-Benzyl-b-carboline-3-carbonyl)-L-methionine ID: ALA1096616
PubChem CID: 46192876
Max Phase: Preclinical
Molecular Formula: C24H23N3O3S
Molecular Weight: 433.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CSCC[C@H](NC(=O)c1cc2c3ccccc3n(Cc3ccccc3)c2cn1)C(=O)O
Standard InChI: InChI=1S/C24H23N3O3S/c1-31-12-11-19(24(29)30)26-23(28)20-13-18-17-9-5-6-10-21(17)27(22(18)14-25-20)15-16-7-3-2-4-8-16/h2-10,13-14,19H,11-12,15H2,1H3,(H,26,28)(H,29,30)/t19-/m0/s1
Standard InChI Key: NLMSCZGXLFFYDI-IBGZPJMESA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-3.5531 -16.5181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2777 -16.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5324 -15.6933 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6654 -13.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1604 -14.1702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8337 -14.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8479 -13.6013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5185 -14.3567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0118 -15.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7389 -14.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7452 -15.4490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0321 -15.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3124 -15.4573 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3102 -14.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0238 -14.2119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5947 -14.2150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1188 -14.6292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5928 -13.3901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8342 -14.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5477 -14.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8362 -13.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2632 -14.2218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5458 -15.4576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5516 -12.9826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5477 -12.1618 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.9768 -16.4801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7009 -16.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7221 -17.6995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0132 -18.1298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2920 -17.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8312 -11.7528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14 15 2 0
15 10 1 0
8 9 1 0
14 16 1 0
16 17 1 0
4 5 2 0
16 18 2 0
9 3 1 0
17 19 1 0
3 11 1 0
19 20 1 0
10 8 1 0
19 21 1 1
1 3 1 0
20 22 1 0
5 6 1 0
20 23 2 0
10 11 2 0
21 24 1 0
6 9 2 0
25 24 1 0
11 12 1 0
2 26 2 0
1 2 1 0
26 27 1 0
12 13 2 0
27 28 2 0
8 7 2 0
28 29 1 0
13 14 1 0
29 30 2 0
30 2 1 0
7 4 1 0
25 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.53Molecular Weight (Monoisotopic): 433.1460AlogP: 4.17#Rotatable Bonds: 8Polar Surface Area: 84.22Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.69CX Basic pKa: 1.89CX LogP: 3.86CX LogD: 0.67Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.44Np Likeness Score: -0.79
References 1. Ma C, Cao R, Shi B, Li S, Chen Z, Yi W, Peng W, Ren Z, Song H.. (2010) Synthesis and cytotoxic evaluation of N2-benzylated quaternary beta-carboline amino acid ester conjugates., 45 (4): [PMID:20122764 ] [10.1016/j.ejmech.2009.12.060 ]